About 5-phenyl-3-(2-phenylethyl)-4,5-dihydro-1,2-oxazole;hydrochloride
5-phenyl-3-(2-phenylethyl)-4,5-dihydro-1,2-oxazole;hydrochloride (PubChem CID 44585632) has the molecular formula C17H18ClNO
and a molecular weight of 287.79 g/mol. Its IUPAC name is 5-phenyl-3-(2-phenylethyl)-4,5-dihydro-1,2-oxazole;hydrochloride.
Molecular Properties
| Compound Name | 5-phenyl-3-(2-phenylethyl)-4,5-dihydro-1,2-oxazole;hydrochloride |
| PubChem CID | 44585632 |
| Molecular Formula | C17H18ClNO |
| Molecular Weight | 287.79 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 5-phenyl-3-(2-phenylethyl)-4,5-dihydro-1,2-oxazole;hydrochloride |
| SMILES | Cl.c1ccc(CCC2=NOC(c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C17H17NO.ClH/c1-3-7-14(8-4-1)11-12-16-13-17(19-18-16)15-9-5-2-6-10-15;/h1-10,17H,11-13H2;1H |
| InChIKey | LBPDBJPGQXEYET-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.79 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-phenyl-3-(2-phenylethyl)-4,5-dihydro-1,2-oxazole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-phenyl-3-(2-phenylethyl)-4,5-dihydro-1,2-oxazole;hydrochloride?
The IUPAC name of 5-phenyl-3-(2-phenylethyl)-4,5-dihydro-1,2-oxazole;hydrochloride (CID 44585632) is 5-phenyl-3-(2-phenylethyl)-4,5-dihydro-1,2-oxazole;hydrochloride.
What is the SMILES notation for 5-phenyl-3-(2-phenylethyl)-4,5-dihydro-1,2-oxazole;hydrochloride?
The canonical SMILES for 5-phenyl-3-(2-phenylethyl)-4,5-dihydro-1,2-oxazole;hydrochloride is Cl.c1ccc(CCC2=NOC(c3ccccc3)C2)cc1.
What is the InChIKey of 5-phenyl-3-(2-phenylethyl)-4,5-dihydro-1,2-oxazole;hydrochloride?
The InChIKey is LBPDBJPGQXEYET-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17NO.ClH/c1-3-7-14(8-4-1)11-12-16-13-17(19-18-16)15-9-5-2-6-10-15;/h1-10,17H,11-13H2;1H.
What are the key properties of 5-phenyl-3-(2-phenylethyl)-4,5-dihydro-1,2-oxazole;hydrochloride?
5-phenyl-3-(2-phenylethyl)-4,5-dihydro-1,2-oxazole;hydrochloride has a molecular weight of 287.79 g/mol, XLogP of 4.56, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-phenyl-3-(2-phenylethyl)-4,5-dihydro-1,2-oxazole;hydrochloride is sourced from PubChem (CID 44585632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).