About 2-[7,8-bis(4-chlorophenyl)-5-piperidin-1-yl-2-azabicyclo[3.2.2]nonan-2-yl]ethanamine
2-[7,8-bis(4-chlorophenyl)-5-piperidin-1-yl-2-azabicyclo[3.2.2]nonan-2-yl]ethanamine (PubChem CID 44585645) has the molecular formula C27H35Cl2N3
and a molecular weight of 472.50 g/mol. Its IUPAC name is 2-[7,8-bis(4-chlorophenyl)-5-piperidin-1-yl-2-azabicyclo[3.2.2]nonan-2-yl]ethanamine.
Molecular Properties
| Compound Name | 2-[7,8-bis(4-chlorophenyl)-5-piperidin-1-yl-2-azabicyclo[3.2.2]nonan-2-yl]ethanamine |
| PubChem CID | 44585645 |
| Molecular Formula | C27H35Cl2N3 |
| Molecular Weight | 472.50 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | 2-[7,8-bis(4-chlorophenyl)-5-piperidin-1-yl-2-azabicyclo[3.2.2]nonan-2-yl]ethanamine |
| SMILES | NCCN1CCC2(N3CCCCC3)CC(c3ccc(Cl)cc3)C1C(c1ccc(Cl)cc1)C2 |
| InChI | InChI=1S/C27H35Cl2N3/c28-22-8-4-20(5-9-22)24-18-27(32-14-2-1-3-15-32)12-16-31(17-13-30)26(24)25(19-27)21-6-10-23(29)11-7-21/h4-11,24-26H,1-3,12-19,30H2 |
| InChIKey | AXRODXJNFUJSHT-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 472.50 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[7,8-bis(4-chlorophenyl)-5-piperidin-1-yl-2-azabicyclo[3.2.2]nonan-2-yl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[7,8-bis(4-chlorophenyl)-5-piperidin-1-yl-2-azabicyclo[3.2.2]nonan-2-yl]ethanamine?
The IUPAC name of 2-[7,8-bis(4-chlorophenyl)-5-piperidin-1-yl-2-azabicyclo[3.2.2]nonan-2-yl]ethanamine (CID 44585645) is 2-[7,8-bis(4-chlorophenyl)-5-piperidin-1-yl-2-azabicyclo[3.2.2]nonan-2-yl]ethanamine.
What is the SMILES notation for 2-[7,8-bis(4-chlorophenyl)-5-piperidin-1-yl-2-azabicyclo[3.2.2]nonan-2-yl]ethanamine?
The canonical SMILES for 2-[7,8-bis(4-chlorophenyl)-5-piperidin-1-yl-2-azabicyclo[3.2.2]nonan-2-yl]ethanamine is NCCN1CCC2(N3CCCCC3)CC(c3ccc(Cl)cc3)C1C(c1ccc(Cl)cc1)C2.
What is the InChIKey of 2-[7,8-bis(4-chlorophenyl)-5-piperidin-1-yl-2-azabicyclo[3.2.2]nonan-2-yl]ethanamine?
The InChIKey is AXRODXJNFUJSHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H35Cl2N3/c28-22-8-4-20(5-9-22)24-18-27(32-14-2-1-3-15-32)12-16-31(17-13-30)26(24)25(19-27)21-6-10-23(29)11-7-21/h4-11,24-26H,1-3,12-19,30H2.
What are the key properties of 2-[7,8-bis(4-chlorophenyl)-5-piperidin-1-yl-2-azabicyclo[3.2.2]nonan-2-yl]ethanamine?
2-[7,8-bis(4-chlorophenyl)-5-piperidin-1-yl-2-azabicyclo[3.2.2]nonan-2-yl]ethanamine has a molecular weight of 472.50 g/mol, XLogP of 5.91, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[7,8-bis(4-chlorophenyl)-5-piperidin-1-yl-2-azabicyclo[3.2.2]nonan-2-yl]ethanamine is sourced from PubChem (CID 44585645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).