C31H23FN2O3 — CID 44585901
3-[(3-fluorophenyl)methyl]-4-[[3-(quinolin-8-ylmethyl)benzoyl]amino]benzoic acid (PubChem CID 44585901) has the molecular formula C31H23FN2O3 and a molecular weight of 490.53 g/mol. Its IUPAC name is 3-[(3-fluorophenyl)methyl]-4-[[3-(quinolin-8-ylmethyl)benzoyl]amino]benzoic acid.
| Compound Name | 3-[(3-fluorophenyl)methyl]-4-[[3-(quinolin-8-ylmethyl)benzoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 44585901 |
| Molecular Formula | C31H23FN2O3 |
| Molecular Weight | 490.53 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | 3-[(3-fluorophenyl)methyl]-4-[[3-(quinolin-8-ylmethyl)benzoyl]amino]benzoic acid |
| SMILES | O=C(O)c1ccc(NC(=O)c2cccc(Cc3cccc4cccnc34)c2)c(Cc2cccc(F)c2)c1 |
| InChI | InChI=1S/C31H23FN2O3/c32-27-11-2-6-21(18-27)17-26-19-25(31(36)37)12-13-28(26)34-30(35)24-9-1-5-20(16-24)15-23-8-3-7-22-10-4-14-33-29(22)23/h1-14,16,18-19H,15,17H2,(H,34,35)(H,36,37) |
| InChIKey | MXFCGSUOQATQFO-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.53 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |