About 2-phenyl-4-phenylmethoxy-[1,2,4]triazolo[4,3-a]quinoxalin-1-one
2-phenyl-4-phenylmethoxy-[1,2,4]triazolo[4,3-a]quinoxalin-1-one (PubChem CID 44586297) has the molecular formula C22H16N4O2
and a molecular weight of 368.40 g/mol. Its IUPAC name is 2-phenyl-4-phenylmethoxy-[1,2,4]triazolo[4,3-a]quinoxalin-1-one.
Molecular Properties
| Compound Name | 2-phenyl-4-phenylmethoxy-[1,2,4]triazolo[4,3-a]quinoxalin-1-one |
| PubChem CID | 44586297 |
| Molecular Formula | C22H16N4O2 |
| Molecular Weight | 368.40 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 2-phenyl-4-phenylmethoxy-[1,2,4]triazolo[4,3-a]quinoxalin-1-one |
| SMILES | O=c1n(-c2ccccc2)nc2c(OCc3ccccc3)nc3ccccc3n12 |
| InChI | InChI=1S/C22H16N4O2/c27-22-25-19-14-8-7-13-18(19)23-21(28-15-16-9-3-1-4-10-16)20(25)24-26(22)17-11-5-2-6-12-17/h1-14H,15H2 |
| InChIKey | OJGDXIRWEDPHFM-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.40 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-phenyl-4-phenylmethoxy-[1,2,4]triazolo[4,3-a]quinoxalin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-4-phenylmethoxy-[1,2,4]triazolo[4,3-a]quinoxalin-1-one?
The IUPAC name of 2-phenyl-4-phenylmethoxy-[1,2,4]triazolo[4,3-a]quinoxalin-1-one (CID 44586297) is 2-phenyl-4-phenylmethoxy-[1,2,4]triazolo[4,3-a]quinoxalin-1-one.
What is the SMILES notation for 2-phenyl-4-phenylmethoxy-[1,2,4]triazolo[4,3-a]quinoxalin-1-one?
The canonical SMILES for 2-phenyl-4-phenylmethoxy-[1,2,4]triazolo[4,3-a]quinoxalin-1-one is O=c1n(-c2ccccc2)nc2c(OCc3ccccc3)nc3ccccc3n12.
What is the InChIKey of 2-phenyl-4-phenylmethoxy-[1,2,4]triazolo[4,3-a]quinoxalin-1-one?
The InChIKey is OJGDXIRWEDPHFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16N4O2/c27-22-25-19-14-8-7-13-18(19)23-21(28-15-16-9-3-1-4-10-16)20(25)24-26(22)17-11-5-2-6-12-17/h1-14H,15H2.
What are the key properties of 2-phenyl-4-phenylmethoxy-[1,2,4]triazolo[4,3-a]quinoxalin-1-one?
2-phenyl-4-phenylmethoxy-[1,2,4]triazolo[4,3-a]quinoxalin-1-one has a molecular weight of 368.40 g/mol, XLogP of 3.61, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-4-phenylmethoxy-[1,2,4]triazolo[4,3-a]quinoxalin-1-one is sourced from PubChem (CID 44586297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).