C34H38Br4N4O2 — CID 44586419
N-(4-bromophenyl)-1-[10-[4-[(4-bromophenyl)carbamoyl]pyridin-1-ium-1-yl]decyl]pyridin-1-ium-4-carboxamide dibromide (PubChem CID 44586419) has the molecular formula C34H38Br4N4O2 and a molecular weight of 854.32 g/mol. Its IUPAC name is N-(4-bromophenyl)-1-[10-[4-[(4-bromophenyl)carbamoyl]pyridin-1-ium-1-yl]decyl]pyridin-1-ium-4-carboxamide dibromide.
| Compound Name | N-(4-bromophenyl)-1-[10-[4-[(4-bromophenyl)carbamoyl]pyridin-1-ium-1-yl]decyl]pyridin-1-ium-4-carboxamide dibromide |
|---|---|
| PubChem CID | 44586419 |
| Molecular Formula | C34H38Br4N4O2 |
| Molecular Weight | 854.32 g/mol |
| Exact Mass | 849.97 |
| IUPAC Name | N-(4-bromophenyl)-1-[10-[4-[(4-bromophenyl)carbamoyl]pyridin-1-ium-1-yl]decyl]pyridin-1-ium-4-carboxamide dibromide |
| SMILES | O=C(Nc1ccc(Br)cc1)c1cc[n+](CCCCCCCCCC[n+]2ccc(C(=O)Nc3ccc(Br)cc3)cc2)cc1.[Br-].[Br-] |
| InChI | InChI=1S/C34H36Br2N4O2.2BrH/c35-29-9-13-31(14-10-29)37-33(41)27-17-23-39(24-18-27)21-7-5-3-1-2-4-6-8-22-40-25-19-28(20-26-40)34(42)38-32-15-11-30(36)12-16-32;;/h9-20,23-26H,1-8,21-22H2;2*1H |
| InChIKey | GNUONJGFUIKEJH-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 854.32 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|