About 2-(ethylamino)pyrano[2,3-g][1,3]benzothiazol-7-one
2-(ethylamino)pyrano[2,3-g][1,3]benzothiazol-7-one (PubChem CID 44586697) has the molecular formula C12H10N2O2S
and a molecular weight of 246.29 g/mol. Its IUPAC name is 2-(ethylamino)pyrano[2,3-g][1,3]benzothiazol-7-one.
Molecular Properties
| Compound Name | 2-(ethylamino)pyrano[2,3-g][1,3]benzothiazol-7-one |
| PubChem CID | 44586697 |
| Molecular Formula | C12H10N2O2S |
| Molecular Weight | 246.29 g/mol |
| Exact Mass | 246.05 |
| IUPAC Name | 2-(ethylamino)pyrano[2,3-g][1,3]benzothiazol-7-one |
| SMILES | CCNc1nc2ccc3oc(=O)ccc3c2s1 |
| InChI | InChI=1S/C12H10N2O2S/c1-2-13-12-14-8-4-5-9-7(11(8)17-12)3-6-10(15)16-9/h3-6H,2H2,1H3,(H,13,14) |
| InChIKey | FEMWZBAEMANNEI-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.29 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 2-(ethylamino)pyrano[2,3-g][1,3]benzothiazol-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(ethylamino)pyrano[2,3-g][1,3]benzothiazol-7-one?
The IUPAC name of 2-(ethylamino)pyrano[2,3-g][1,3]benzothiazol-7-one (CID 44586697) is 2-(ethylamino)pyrano[2,3-g][1,3]benzothiazol-7-one.
What is the SMILES notation for 2-(ethylamino)pyrano[2,3-g][1,3]benzothiazol-7-one?
The canonical SMILES for 2-(ethylamino)pyrano[2,3-g][1,3]benzothiazol-7-one is CCNc1nc2ccc3oc(=O)ccc3c2s1.
What is the InChIKey of 2-(ethylamino)pyrano[2,3-g][1,3]benzothiazol-7-one?
The InChIKey is FEMWZBAEMANNEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N2O2S/c1-2-13-12-14-8-4-5-9-7(11(8)17-12)3-6-10(15)16-9/h3-6H,2H2,1H3,(H,13,14).
What are the key properties of 2-(ethylamino)pyrano[2,3-g][1,3]benzothiazol-7-one?
2-(ethylamino)pyrano[2,3-g][1,3]benzothiazol-7-one has a molecular weight of 246.29 g/mol, XLogP of 2.83, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(ethylamino)pyrano[2,3-g][1,3]benzothiazol-7-one is sourced from PubChem (CID 44586697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).