C11H10F3NO2S — CID 44586753
(3R,4S)-3-methoxy-1-methylsulfanyl-4-(2,3,5-trifluorophenyl)azetidin-2-one (PubChem CID 44586753) has the molecular formula C11H10F3NO2S and a molecular weight of 277.27 g/mol. Its IUPAC name is (3R,4S)-3-methoxy-1-methylsulfanyl-4-(2,3,5-trifluorophenyl)azetidin-2-one.
| Compound Name | (3R,4S)-3-methoxy-1-methylsulfanyl-4-(2,3,5-trifluorophenyl)azetidin-2-one |
|---|---|
| PubChem CID | 44586753 |
| Molecular Formula | C11H10F3NO2S |
| Molecular Weight | 277.27 g/mol |
| Exact Mass | 277.04 |
| IUPAC Name | (3R,4S)-3-methoxy-1-methylsulfanyl-4-(2,3,5-trifluorophenyl)azetidin-2-one |
| SMILES | CO[C@H]1C(=O)N(SC)[C@H]1c1cc(F)cc(F)c1F |
| InChI | InChI=1S/C11H10F3NO2S/c1-17-10-9(15(18-2)11(10)16)6-3-5(12)4-7(13)8(6)14/h3-4,9-10H,1-2H3/t9-,10+/m0/s1 |
| InChIKey | LIXZMQKWADXRMS-VHSXEESVSA-N |
| XLogP | 2.28 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.27 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|