C18H25NO3S2 — CID 44586761
(2S,5S)-1-[(2S)-2-methyl-3-sulfanylpropanoyl]-5-(3-phenylpropylsulfanyl)pyrrolidine-2-carboxylic acid (PubChem CID 44586761) has the molecular formula C18H25NO3S2 and a molecular weight of 367.54 g/mol. Its IUPAC name is (2S,5S)-1-[(2S)-2-methyl-3-sulfanylpropanoyl]-5-(3-phenylpropylsulfanyl)pyrrolidine-2-carboxylic acid.
| Compound Name | (2S,5S)-1-[(2S)-2-methyl-3-sulfanylpropanoyl]-5-(3-phenylpropylsulfanyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 44586761 |
| Molecular Formula | C18H25NO3S2 |
| Molecular Weight | 367.54 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | (2S,5S)-1-[(2S)-2-methyl-3-sulfanylpropanoyl]-5-(3-phenylpropylsulfanyl)pyrrolidine-2-carboxylic acid |
| SMILES | C[C@H](CS)C(=O)N1[C@@H](SCCCc2ccccc2)CC[C@H]1C(=O)O |
| InChI | InChI=1S/C18H25NO3S2/c1-13(12-23)17(20)19-15(18(21)22)9-10-16(19)24-11-5-8-14-6-3-2-4-7-14/h2-4,6-7,13,15-16,23H,5,8-12H2,1H3,(H,21,22)/t13-,15+,16+/m1/s1 |
| InChIKey | CGPUJSIVRWHBDZ-KBMXLJTQSA-N |
| XLogP | 3.32 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.54 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|