About [(3R,4S)-1-methylsulfanyl-2-oxo-4-[(E)-2-phenylethenyl]azetidin-3-yl] acetate
[(3R,4S)-1-methylsulfanyl-2-oxo-4-[(E)-2-phenylethenyl]azetidin-3-yl] acetate (PubChem CID 44586811) has the molecular formula C14H15NO3S
and a molecular weight of 277.34 g/mol. Its IUPAC name is [(3R,4S)-1-methylsulfanyl-2-oxo-4-[(E)-2-phenylethenyl]azetidin-3-yl] acetate.
Molecular Properties
| Compound Name | [(3R,4S)-1-methylsulfanyl-2-oxo-4-[(E)-2-phenylethenyl]azetidin-3-yl] acetate |
| PubChem CID | 44586811 |
| Molecular Formula | C14H15NO3S |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | [(3R,4S)-1-methylsulfanyl-2-oxo-4-[(E)-2-phenylethenyl]azetidin-3-yl] acetate |
| SMILES | CSN1C(=O)[C@H](OC(C)=O)[C@@H]1/C=C/c1ccccc1 |
| InChI | InChI=1S/C14H15NO3S/c1-10(16)18-13-12(15(19-2)14(13)17)9-8-11-6-4-3-5-7-11/h3-9,12-13H,1-2H3/b9-8+/t12-,13+/m0/s1 |
| InChIKey | XZZFEQXMHCUFCH-AYSSICMYSA-N |
| XLogP | 2.12 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(3R,4S)-1-methylsulfanyl-2-oxo-4-[(E)-2-phenylethenyl]azetidin-3-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R,4S)-1-methylsulfanyl-2-oxo-4-[(E)-2-phenylethenyl]azetidin-3-yl] acetate?
The IUPAC name of [(3R,4S)-1-methylsulfanyl-2-oxo-4-[(E)-2-phenylethenyl]azetidin-3-yl] acetate (CID 44586811) is [(3R,4S)-1-methylsulfanyl-2-oxo-4-[(E)-2-phenylethenyl]azetidin-3-yl] acetate.
What is the SMILES notation for [(3R,4S)-1-methylsulfanyl-2-oxo-4-[(E)-2-phenylethenyl]azetidin-3-yl] acetate?
The canonical SMILES for [(3R,4S)-1-methylsulfanyl-2-oxo-4-[(E)-2-phenylethenyl]azetidin-3-yl] acetate is CSN1C(=O)[C@H](OC(C)=O)[C@@H]1/C=C/c1ccccc1.
What is the InChIKey of [(3R,4S)-1-methylsulfanyl-2-oxo-4-[(E)-2-phenylethenyl]azetidin-3-yl] acetate?
The InChIKey is XZZFEQXMHCUFCH-AYSSICMYSA-N. The full InChI is InChI=1S/C14H15NO3S/c1-10(16)18-13-12(15(19-2)14(13)17)9-8-11-6-4-3-5-7-11/h3-9,12-13H,1-2H3/b9-8+/t12-,13+/m0/s1.
What are the key properties of [(3R,4S)-1-methylsulfanyl-2-oxo-4-[(E)-2-phenylethenyl]azetidin-3-yl] acetate?
[(3R,4S)-1-methylsulfanyl-2-oxo-4-[(E)-2-phenylethenyl]azetidin-3-yl] acetate has a molecular weight of 277.34 g/mol, XLogP of 2.12, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R,4S)-1-methylsulfanyl-2-oxo-4-[(E)-2-phenylethenyl]azetidin-3-yl] acetate is sourced from PubChem (CID 44586811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).