C16H22O6 — CID 44586864
(2R,3R,4R,5R,6S)-2-(hydroxymethyl)-6-[2-(4-methoxyphenyl)prop-2-enyl]oxane-3,4,5-triol (PubChem CID 44586864) has the molecular formula C16H22O6 and a molecular weight of 310.35 g/mol. Its IUPAC name is (2R,3R,4R,5R,6S)-2-(hydroxymethyl)-6-[2-(4-methoxyphenyl)prop-2-enyl]oxane-3,4,5-triol.
| Compound Name | (2R,3R,4R,5R,6S)-2-(hydroxymethyl)-6-[2-(4-methoxyphenyl)prop-2-enyl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 44586864 |
| Molecular Formula | C16H22O6 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | (2R,3R,4R,5R,6S)-2-(hydroxymethyl)-6-[2-(4-methoxyphenyl)prop-2-enyl]oxane-3,4,5-triol |
| SMILES | C=C(C[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C16H22O6/c1-9(10-3-5-11(21-2)6-4-10)7-12-14(18)16(20)15(19)13(8-17)22-12/h3-6,12-20H,1,7-8H2,2H3/t12-,13+,14-,15-,16+/m0/s1 |
| InChIKey | ZOFWFKGGABIZNL-XFIYOXNOSA-N |
| XLogP | -0.06 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |