C15H19NO7 — CID 44586891
(2R,3R,4R,5R,6S)-2-(hydroxymethyl)-6-[2-(3-nitrophenyl)prop-2-enyl]oxane-3,4,5-triol (PubChem CID 44586891) has the molecular formula C15H19NO7 and a molecular weight of 325.32 g/mol. Its IUPAC name is (2R,3R,4R,5R,6S)-2-(hydroxymethyl)-6-[2-(3-nitrophenyl)prop-2-enyl]oxane-3,4,5-triol.
| Compound Name | (2R,3R,4R,5R,6S)-2-(hydroxymethyl)-6-[2-(3-nitrophenyl)prop-2-enyl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 44586891 |
| Molecular Formula | C15H19NO7 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | (2R,3R,4R,5R,6S)-2-(hydroxymethyl)-6-[2-(3-nitrophenyl)prop-2-enyl]oxane-3,4,5-triol |
| SMILES | C=C(C[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H19NO7/c1-8(9-3-2-4-10(6-9)16(21)22)5-11-13(18)15(20)14(19)12(7-17)23-11/h2-4,6,11-15,17-20H,1,5,7H2/t11-,12+,13-,14-,15+/m0/s1 |
| InChIKey | WRUFFRAOJDJDKO-AIEDFZFUSA-N |
| XLogP | -0.16 |
| TPSA | 133.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|