C31H40ClNO3 — CID 44586915
[(1S,9R,10S)-17-(cyclobutylmethyl)-10-hydroxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl] 2-(4-methylphenyl)propanoate;hydrochloride (PubChem CID 44586915) has the molecular formula C31H40ClNO3 and a molecular weight of 510.12 g/mol. Its IUPAC name is [(1S,9R,10S)-17-(cyclobutylmethyl)-10-hydroxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl] 2-(4-methylphenyl)propanoate;hydrochloride.
| Compound Name | [(1S,9R,10S)-17-(cyclobutylmethyl)-10-hydroxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl] 2-(4-methylphenyl)propanoate;hydrochloride |
|---|---|
| PubChem CID | 44586915 |
| Molecular Formula | C31H40ClNO3 |
| Molecular Weight | 510.12 g/mol |
| Exact Mass | 509.27 |
| IUPAC Name | [(1S,9R,10S)-17-(cyclobutylmethyl)-10-hydroxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl] 2-(4-methylphenyl)propanoate;hydrochloride |
| SMILES | Cc1ccc(C(C)C(=O)Oc2ccc3c(c2)[C@@]24CCCC[C@@]2(O)[C@@H](C3)N(CC2CCC2)CC4)cc1.Cl |
| InChI | InChI=1S/C31H39NO3.ClH/c1-21-8-10-24(11-9-21)22(2)29(33)35-26-13-12-25-18-28-31(34)15-4-3-14-30(31,27(25)19-26)16-17-32(28)20-23-6-5-7-23;/h8-13,19,22-23,28,34H,3-7,14-18,20H2,1-2H3;1H/t22?,28-,30+,31-;/m1./s1 |
| InChIKey | OPVJGIFHGWOMJP-WIDZDDMQSA-N |
| XLogP | 6.10 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.12 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|