C20H16ClFN4O — CID 44586999
N-[3-[3-(2-chloro-4-fluorophenyl)-1,2,4-oxadiazol-5-yl]propyl]quinolin-6-amine (PubChem CID 44586999) has the molecular formula C20H16ClFN4O and a molecular weight of 382.83 g/mol. Its IUPAC name is N-[3-[3-(2-chloro-4-fluorophenyl)-1,2,4-oxadiazol-5-yl]propyl]quinolin-6-amine.
| Compound Name | N-[3-[3-(2-chloro-4-fluorophenyl)-1,2,4-oxadiazol-5-yl]propyl]quinolin-6-amine |
|---|---|
| PubChem CID | 44586999 |
| Molecular Formula | C20H16ClFN4O |
| Molecular Weight | 382.83 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | N-[3-[3-(2-chloro-4-fluorophenyl)-1,2,4-oxadiazol-5-yl]propyl]quinolin-6-amine |
| SMILES | Fc1ccc(-c2noc(CCCNc3ccc4ncccc4c3)n2)c(Cl)c1 |
| InChI | InChI=1S/C20H16ClFN4O/c21-17-12-14(22)5-7-16(17)20-25-19(27-26-20)4-2-9-23-15-6-8-18-13(11-15)3-1-10-24-18/h1,3,5-8,10-12,23H,2,4,9H2 |
| InChIKey | UBHDNCMVRICFAM-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.83 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|