About (4-fluorophenyl)methyl benzoate
(4-fluorophenyl)methyl benzoate (PubChem CID 44587009) has the molecular formula C14H11FO2
and a molecular weight of 230.24 g/mol. Its IUPAC name is (4-fluorophenyl)methyl benzoate.
Molecular Properties
| Compound Name | (4-fluorophenyl)methyl benzoate |
| PubChem CID | 44587009 |
| Molecular Formula | C14H11FO2 |
| Molecular Weight | 230.24 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | (4-fluorophenyl)methyl benzoate |
| SMILES | O=C(OCc1ccc(F)cc1)c1ccccc1 |
| InChI | InChI=1S/C14H11FO2/c15-13-8-6-11(7-9-13)10-17-14(16)12-4-2-1-3-5-12/h1-9H,10H2 |
| InChIKey | DVTATUAZGVHURR-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.24 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4-fluorophenyl)methyl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-fluorophenyl)methyl benzoate?
The IUPAC name of (4-fluorophenyl)methyl benzoate (CID 44587009) is (4-fluorophenyl)methyl benzoate.
What is the SMILES notation for (4-fluorophenyl)methyl benzoate?
The canonical SMILES for (4-fluorophenyl)methyl benzoate is O=C(OCc1ccc(F)cc1)c1ccccc1.
What is the InChIKey of (4-fluorophenyl)methyl benzoate?
The InChIKey is DVTATUAZGVHURR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11FO2/c15-13-8-6-11(7-9-13)10-17-14(16)12-4-2-1-3-5-12/h1-9H,10H2.
What are the key properties of (4-fluorophenyl)methyl benzoate?
(4-fluorophenyl)methyl benzoate has a molecular weight of 230.24 g/mol, XLogP of 3.18, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-fluorophenyl)methyl benzoate is sourced from PubChem (CID 44587009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).