C25H38O6 — CID 44587241
decyl 2-[(2S,4R,6S)-2-hydroxy-11-oxo-5,7-dioxadispiro[5.1.58.26]pentadeca-9,12-dien-4-yl]acetate (PubChem CID 44587241) has the molecular formula C25H38O6 and a molecular weight of 434.57 g/mol. Its IUPAC name is decyl 2-[(2S,4R,6S)-2-hydroxy-11-oxo-5,7-dioxadispiro[5.1.58.26]pentadeca-9,12-dien-4-yl]acetate.
| Compound Name | decyl 2-[(2S,4R,6S)-2-hydroxy-11-oxo-5,7-dioxadispiro[5.1.58.26]pentadeca-9,12-dien-4-yl]acetate |
|---|---|
| PubChem CID | 44587241 |
| Molecular Formula | C25H38O6 |
| Molecular Weight | 434.57 g/mol |
| Exact Mass | 434.27 |
| IUPAC Name | decyl 2-[(2S,4R,6S)-2-hydroxy-11-oxo-5,7-dioxadispiro[5.1.58.26]pentadeca-9,12-dien-4-yl]acetate |
| SMILES | CCCCCCCCCCOC(=O)C[C@H]1C[C@H](O)C[C@@]2(CCC3(C=CC(=O)C=C3)O2)O1 |
| InChI | InChI=1S/C25H38O6/c1-2-3-4-5-6-7-8-9-16-29-23(28)18-22-17-21(27)19-25(30-22)15-14-24(31-25)12-10-20(26)11-13-24/h10-13,21-22,27H,2-9,14-19H2,1H3/t21-,22+,25-/m0/s1 |
| InChIKey | CTXOKHRRGGEYEW-FBLLAGFSSA-N |
| XLogP | 4.54 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.57 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|