C11H12FNO2S — CID 44587308
(3R,4S)-4-(3-fluorophenyl)-3-methoxy-1-methylsulfanylazetidin-2-one (PubChem CID 44587308) has the molecular formula C11H12FNO2S and a molecular weight of 241.29 g/mol. Its IUPAC name is (3R,4S)-4-(3-fluorophenyl)-3-methoxy-1-methylsulfanylazetidin-2-one.
| Compound Name | (3R,4S)-4-(3-fluorophenyl)-3-methoxy-1-methylsulfanylazetidin-2-one |
|---|---|
| PubChem CID | 44587308 |
| Molecular Formula | C11H12FNO2S |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | (3R,4S)-4-(3-fluorophenyl)-3-methoxy-1-methylsulfanylazetidin-2-one |
| SMILES | CO[C@H]1C(=O)N(SC)[C@H]1c1cccc(F)c1 |
| InChI | InChI=1S/C11H12FNO2S/c1-15-10-9(13(16-2)11(10)14)7-4-3-5-8(12)6-7/h3-6,9-10H,1-2H3/t9-,10+/m0/s1 |
| InChIKey | MZGMTWWSUYAFKV-VHSXEESVSA-N |
| XLogP | 2.00 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|