About 2-nitrooxyethyl 2-[4-(thiophene-2-carbonyl)phenyl]propanoate
2-nitrooxyethyl 2-[4-(thiophene-2-carbonyl)phenyl]propanoate (PubChem CID 44587408) has the molecular formula C16H15NO6S
and a molecular weight of 349.36 g/mol. Its IUPAC name is 2-nitrooxyethyl 2-[4-(thiophene-2-carbonyl)phenyl]propanoate.
Molecular Properties
| Compound Name | 2-nitrooxyethyl 2-[4-(thiophene-2-carbonyl)phenyl]propanoate |
| PubChem CID | 44587408 |
| Molecular Formula | C16H15NO6S |
| Molecular Weight | 349.36 g/mol |
| Exact Mass | 349.06 |
| IUPAC Name | 2-nitrooxyethyl 2-[4-(thiophene-2-carbonyl)phenyl]propanoate |
| SMILES | CC(C(=O)OCCO[N+](=O)[O-])c1ccc(C(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C16H15NO6S/c1-11(16(19)22-8-9-23-17(20)21)12-4-6-13(7-5-12)15(18)14-3-2-10-24-14/h2-7,10-11H,8-9H2,1H3 |
| InChIKey | XVFQMXWWGPLDRE-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.36 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-nitrooxyethyl 2-[4-(thiophene-2-carbonyl)phenyl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nitrooxyethyl 2-[4-(thiophene-2-carbonyl)phenyl]propanoate?
The IUPAC name of 2-nitrooxyethyl 2-[4-(thiophene-2-carbonyl)phenyl]propanoate (CID 44587408) is 2-nitrooxyethyl 2-[4-(thiophene-2-carbonyl)phenyl]propanoate.
What is the SMILES notation for 2-nitrooxyethyl 2-[4-(thiophene-2-carbonyl)phenyl]propanoate?
The canonical SMILES for 2-nitrooxyethyl 2-[4-(thiophene-2-carbonyl)phenyl]propanoate is CC(C(=O)OCCO[N+](=O)[O-])c1ccc(C(=O)c2cccs2)cc1.
What is the InChIKey of 2-nitrooxyethyl 2-[4-(thiophene-2-carbonyl)phenyl]propanoate?
The InChIKey is XVFQMXWWGPLDRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15NO6S/c1-11(16(19)22-8-9-23-17(20)21)12-4-6-13(7-5-12)15(18)14-3-2-10-24-14/h2-7,10-11H,8-9H2,1H3.
What are the key properties of 2-nitrooxyethyl 2-[4-(thiophene-2-carbonyl)phenyl]propanoate?
2-nitrooxyethyl 2-[4-(thiophene-2-carbonyl)phenyl]propanoate has a molecular weight of 349.36 g/mol, XLogP of 2.83, 8 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nitrooxyethyl 2-[4-(thiophene-2-carbonyl)phenyl]propanoate is sourced from PubChem (CID 44587408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).