About 11-methylfuro[3,2-c][1,10]phenanthroline
11-methylfuro[3,2-c][1,10]phenanthroline (PubChem CID 44587501) has the molecular formula C15H10N2O
and a molecular weight of 234.26 g/mol. Its IUPAC name is 11-methylfuro[3,2-c][1,10]phenanthroline.
Molecular Properties
| Compound Name | 11-methylfuro[3,2-c][1,10]phenanthroline |
| PubChem CID | 44587501 |
| Molecular Formula | C15H10N2O |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | 11-methylfuro[3,2-c][1,10]phenanthroline |
| SMILES | Cc1nc2c(ccc3cccnc32)c2occc12 |
| InChI | InChI=1S/C15H10N2O/c1-9-11-6-8-18-15(11)12-5-4-10-3-2-7-16-13(10)14(12)17-9/h2-8H,1H3 |
| InChIKey | ZMRRKICFFXQQHB-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 11-methylfuro[3,2-c][1,10]phenanthroline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-methylfuro[3,2-c][1,10]phenanthroline?
The IUPAC name of 11-methylfuro[3,2-c][1,10]phenanthroline (CID 44587501) is 11-methylfuro[3,2-c][1,10]phenanthroline.
What is the SMILES notation for 11-methylfuro[3,2-c][1,10]phenanthroline?
The canonical SMILES for 11-methylfuro[3,2-c][1,10]phenanthroline is Cc1nc2c(ccc3cccnc32)c2occc12.
What is the InChIKey of 11-methylfuro[3,2-c][1,10]phenanthroline?
The InChIKey is ZMRRKICFFXQQHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10N2O/c1-9-11-6-8-18-15(11)12-5-4-10-3-2-7-16-13(10)14(12)17-9/h2-8H,1H3.
What are the key properties of 11-methylfuro[3,2-c][1,10]phenanthroline?
11-methylfuro[3,2-c][1,10]phenanthroline has a molecular weight of 234.26 g/mol, XLogP of 3.84, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 11-methylfuro[3,2-c][1,10]phenanthroline is sourced from PubChem (CID 44587501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).