C17H11NO4 — CID 44587979
8-hydroxy-3,4-dihydro-2H-benzo[j]phenanthridine-1,7,12-trione (PubChem CID 44587979) has the molecular formula C17H11NO4 and a molecular weight of 293.28 g/mol. Its IUPAC name is 8-hydroxy-3,4-dihydro-2H-benzo[j]phenanthridine-1,7,12-trione.
| Compound Name | 8-hydroxy-3,4-dihydro-2H-benzo[j]phenanthridine-1,7,12-trione |
|---|---|
| PubChem CID | 44587979 |
| Molecular Formula | C17H11NO4 |
| Molecular Weight | 293.28 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 8-hydroxy-3,4-dihydro-2H-benzo[j]phenanthridine-1,7,12-trione |
| SMILES | O=C1c2cnc3c(c2C(=O)c2cccc(O)c21)C(=O)CCC3 |
| InChI | InChI=1S/C17H11NO4/c19-11-5-1-3-8-13(11)17(22)9-7-18-10-4-2-6-12(20)15(10)14(9)16(8)21/h1,3,5,7,19H,2,4,6H2 |
| InChIKey | BNKISVQAQFKASF-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 84.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.28 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|