C26H42O11 — CID 44588002
[(2R,3R,4S,5S)-3,4,5,6-tetra(butanoyloxy)oxan-2-yl]methyl butanoate (PubChem CID 44588002) has the molecular formula C26H42O11 and a molecular weight of 530.61 g/mol. Its IUPAC name is [(2R,3R,4S,5S)-3,4,5,6-tetra(butanoyloxy)oxan-2-yl]methyl butanoate.
| Compound Name | [(2R,3R,4S,5S)-3,4,5,6-tetra(butanoyloxy)oxan-2-yl]methyl butanoate |
|---|---|
| PubChem CID | 44588002 |
| Molecular Formula | C26H42O11 |
| Molecular Weight | 530.61 g/mol |
| Exact Mass | 530.27 |
| IUPAC Name | [(2R,3R,4S,5S)-3,4,5,6-tetra(butanoyloxy)oxan-2-yl]methyl butanoate |
| SMILES | CCCC(=O)OC[C@H]1OC(OC(=O)CCC)[C@@H](OC(=O)CCC)[C@@H](OC(=O)CCC)[C@@H]1OC(=O)CCC |
| InChI | InChI=1S/C26H42O11/c1-6-11-18(27)32-16-17-23(34-19(28)12-7-2)24(35-20(29)13-8-3)25(36-21(30)14-9-4)26(33-17)37-22(31)15-10-5/h17,23-26H,6-16H2,1-5H3/t17-,23-,24+,25+,26?/m1/s1 |
| InChIKey | URBLVNWOCAGFPV-MWKUUBLRSA-N |
| XLogP | 3.53 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.61 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|