C20H17NO4 — CID 44588092
8-hydroxy-3,3,6-trimethyl-2,4-dihydrobenzo[j]phenanthridine-1,7,12-trione (PubChem CID 44588092) has the molecular formula C20H17NO4 and a molecular weight of 335.36 g/mol. Its IUPAC name is 8-hydroxy-3,3,6-trimethyl-2,4-dihydrobenzo[j]phenanthridine-1,7,12-trione.
| Compound Name | 8-hydroxy-3,3,6-trimethyl-2,4-dihydrobenzo[j]phenanthridine-1,7,12-trione |
|---|---|
| PubChem CID | 44588092 |
| Molecular Formula | C20H17NO4 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 8-hydroxy-3,3,6-trimethyl-2,4-dihydrobenzo[j]phenanthridine-1,7,12-trione |
| SMILES | Cc1nc2c(c3c1C(=O)c1c(O)cccc1C3=O)C(=O)CC(C)(C)C2 |
| InChI | InChI=1S/C20H17NO4/c1-9-14-17(16-11(21-9)7-20(2,3)8-13(16)23)18(24)10-5-4-6-12(22)15(10)19(14)25/h4-6,22H,7-8H2,1-3H3 |
| InChIKey | DPPHTZVOSLOGOI-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 84.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|