About 6-(4-ethoxyanilino)-2,3-dimethylquinoxaline-5,8-dione
6-(4-ethoxyanilino)-2,3-dimethylquinoxaline-5,8-dione (PubChem CID 44588198) has the molecular formula C18H17N3O3
and a molecular weight of 323.35 g/mol. Its IUPAC name is 6-(4-ethoxyanilino)-2,3-dimethylquinoxaline-5,8-dione.
Molecular Properties
| Compound Name | 6-(4-ethoxyanilino)-2,3-dimethylquinoxaline-5,8-dione |
| PubChem CID | 44588198 |
| Molecular Formula | C18H17N3O3 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 6-(4-ethoxyanilino)-2,3-dimethylquinoxaline-5,8-dione |
| SMILES | CCOc1ccc(NC2=CC(=O)c3nc(C)c(C)nc3C2=O)cc1 |
| InChI | InChI=1S/C18H17N3O3/c1-4-24-13-7-5-12(6-8-13)21-14-9-15(22)16-17(18(14)23)20-11(3)10(2)19-16/h5-9,21H,4H2,1-3H3 |
| InChIKey | GEGGVVAIOIIKBL-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze 6-(4-ethoxyanilino)-2,3-dimethylquinoxaline-5,8-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-ethoxyanilino)-2,3-dimethylquinoxaline-5,8-dione?
The IUPAC name of 6-(4-ethoxyanilino)-2,3-dimethylquinoxaline-5,8-dione (CID 44588198) is 6-(4-ethoxyanilino)-2,3-dimethylquinoxaline-5,8-dione.
What is the SMILES notation for 6-(4-ethoxyanilino)-2,3-dimethylquinoxaline-5,8-dione?
The canonical SMILES for 6-(4-ethoxyanilino)-2,3-dimethylquinoxaline-5,8-dione is CCOc1ccc(NC2=CC(=O)c3nc(C)c(C)nc3C2=O)cc1.
What is the InChIKey of 6-(4-ethoxyanilino)-2,3-dimethylquinoxaline-5,8-dione?
The InChIKey is GEGGVVAIOIIKBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17N3O3/c1-4-24-13-7-5-12(6-8-13)21-14-9-15(22)16-17(18(14)23)20-11(3)10(2)19-16/h5-9,21H,4H2,1-3H3.
What are the key properties of 6-(4-ethoxyanilino)-2,3-dimethylquinoxaline-5,8-dione?
6-(4-ethoxyanilino)-2,3-dimethylquinoxaline-5,8-dione has a molecular weight of 323.35 g/mol, XLogP of 2.87, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-ethoxyanilino)-2,3-dimethylquinoxaline-5,8-dione is sourced from PubChem (CID 44588198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).