About 2-[4-[4-(piperidin-1-ylmethyl)phenyl]phenyl]-N,N-dipropylacetamide
2-[4-[4-(piperidin-1-ylmethyl)phenyl]phenyl]-N,N-dipropylacetamide (PubChem CID 44588349) has the molecular formula C26H36N2O
and a molecular weight of 392.59 g/mol. Its IUPAC name is 2-[4-[4-(piperidin-1-ylmethyl)phenyl]phenyl]-N,N-dipropylacetamide.
Molecular Properties
| Compound Name | 2-[4-[4-(piperidin-1-ylmethyl)phenyl]phenyl]-N,N-dipropylacetamide |
| PubChem CID | 44588349 |
| Molecular Formula | C26H36N2O |
| Molecular Weight | 392.59 g/mol |
| Exact Mass | 392.28 |
| IUPAC Name | 2-[4-[4-(piperidin-1-ylmethyl)phenyl]phenyl]-N,N-dipropylacetamide |
| SMILES | CCCN(CCC)C(=O)Cc1ccc(-c2ccc(CN3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C26H36N2O/c1-3-16-28(17-4-2)26(29)20-22-8-12-24(13-9-22)25-14-10-23(11-15-25)21-27-18-6-5-7-19-27/h8-15H,3-7,16-21H2,1-2H3 |
| InChIKey | ALMYDBLKQQSJKZ-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 392.59 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[4-[4-(piperidin-1-ylmethyl)phenyl]phenyl]-N,N-dipropylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[4-(piperidin-1-ylmethyl)phenyl]phenyl]-N,N-dipropylacetamide?
The IUPAC name of 2-[4-[4-(piperidin-1-ylmethyl)phenyl]phenyl]-N,N-dipropylacetamide (CID 44588349) is 2-[4-[4-(piperidin-1-ylmethyl)phenyl]phenyl]-N,N-dipropylacetamide.
What is the SMILES notation for 2-[4-[4-(piperidin-1-ylmethyl)phenyl]phenyl]-N,N-dipropylacetamide?
The canonical SMILES for 2-[4-[4-(piperidin-1-ylmethyl)phenyl]phenyl]-N,N-dipropylacetamide is CCCN(CCC)C(=O)Cc1ccc(-c2ccc(CN3CCCCC3)cc2)cc1.
What is the InChIKey of 2-[4-[4-(piperidin-1-ylmethyl)phenyl]phenyl]-N,N-dipropylacetamide?
The InChIKey is ALMYDBLKQQSJKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H36N2O/c1-3-16-28(17-4-2)26(29)20-22-8-12-24(13-9-22)25-14-10-23(11-15-25)21-27-18-6-5-7-19-27/h8-15H,3-7,16-21H2,1-2H3.
What are the key properties of 2-[4-[4-(piperidin-1-ylmethyl)phenyl]phenyl]-N,N-dipropylacetamide?
2-[4-[4-(piperidin-1-ylmethyl)phenyl]phenyl]-N,N-dipropylacetamide has a molecular weight of 392.59 g/mol, XLogP of 5.53, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[4-(piperidin-1-ylmethyl)phenyl]phenyl]-N,N-dipropylacetamide is sourced from PubChem (CID 44588349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).