C18H28O4S2 — CID 44588382
[(2R,4R,5S,6R)-6-[bis(ethylsulfanyl)methyl]-5-ethoxy-2-phenyl-1,3-dioxan-4-yl]methanol (PubChem CID 44588382) has the molecular formula C18H28O4S2 and a molecular weight of 372.55 g/mol. Its IUPAC name is [(2R,4R,5S,6R)-6-[bis(ethylsulfanyl)methyl]-5-ethoxy-2-phenyl-1,3-dioxan-4-yl]methanol.
| Compound Name | [(2R,4R,5S,6R)-6-[bis(ethylsulfanyl)methyl]-5-ethoxy-2-phenyl-1,3-dioxan-4-yl]methanol |
|---|---|
| PubChem CID | 44588382 |
| Molecular Formula | C18H28O4S2 |
| Molecular Weight | 372.55 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | [(2R,4R,5S,6R)-6-[bis(ethylsulfanyl)methyl]-5-ethoxy-2-phenyl-1,3-dioxan-4-yl]methanol |
| SMILES | CCO[C@H]1[C@@H](CO)O[C@@H](c2ccccc2)O[C@H]1C(SCC)SCC |
| InChI | InChI=1S/C18H28O4S2/c1-4-20-15-14(12-19)21-17(13-10-8-7-9-11-13)22-16(15)18(23-5-2)24-6-3/h7-11,14-19H,4-6,12H2,1-3H3/t14-,15+,16-,17-/m1/s1 |
| InChIKey | SYSHNFYXYYAEBN-YYIAUSFCSA-N |
| XLogP | 3.70 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.55 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|