C26H28O5 — CID 44588383
(2S,3R,4S,5R)-3,4,5-tris(phenylmethoxy)oxan-2-ol (PubChem CID 44588383) has the molecular formula C26H28O5 and a molecular weight of 420.50 g/mol. Its IUPAC name is (2S,3R,4S,5R)-3,4,5-tris(phenylmethoxy)oxan-2-ol.
| Compound Name | (2S,3R,4S,5R)-3,4,5-tris(phenylmethoxy)oxan-2-ol |
|---|---|
| PubChem CID | 44588383 |
| Molecular Formula | C26H28O5 |
| Molecular Weight | 420.50 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | (2S,3R,4S,5R)-3,4,5-tris(phenylmethoxy)oxan-2-ol |
| SMILES | OC1OC[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C26H28O5/c27-26-25(30-18-22-14-8-3-9-15-22)24(29-17-21-12-6-2-7-13-21)23(19-31-26)28-16-20-10-4-1-5-11-20/h1-15,23-27H,16-19H2/t23-,24+,25-,26?/m1/s1 |
| InChIKey | HTSKDJMXBBFKKG-SIDNZMCZSA-N |
| XLogP | 4.09 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.50 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |