About [3-(1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]methyl piperidine-1-carbodithioate
[3-(1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]methyl piperidine-1-carbodithioate (PubChem CID 44588398) has the molecular formula C20H21N3O4S2
and a molecular weight of 431.54 g/mol. Its IUPAC name is [3-(1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]methyl piperidine-1-carbodithioate.
Molecular Properties
| Compound Name | [3-(1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]methyl piperidine-1-carbodithioate |
| PubChem CID | 44588398 |
| Molecular Formula | C20H21N3O4S2 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | [3-(1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]methyl piperidine-1-carbodithioate |
| SMILES | O=C1CCC(N2C(=O)c3ccccc3C2=O)C(=O)N1CSC(=S)N1CCCCC1 |
| InChI | InChI=1S/C20H21N3O4S2/c24-16-9-8-15(23-17(25)13-6-2-3-7-14(13)18(23)26)19(27)22(16)12-29-20(28)21-10-4-1-5-11-21/h2-3,6-7,15H,1,4-5,8-12H2 |
| InChIKey | GAONTFIHHDQVLS-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [3-(1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]methyl piperidine-1-carbodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]methyl piperidine-1-carbodithioate?
The IUPAC name of [3-(1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]methyl piperidine-1-carbodithioate (CID 44588398) is [3-(1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]methyl piperidine-1-carbodithioate.
What is the SMILES notation for [3-(1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]methyl piperidine-1-carbodithioate?
The canonical SMILES for [3-(1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]methyl piperidine-1-carbodithioate is O=C1CCC(N2C(=O)c3ccccc3C2=O)C(=O)N1CSC(=S)N1CCCCC1.
What is the InChIKey of [3-(1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]methyl piperidine-1-carbodithioate?
The InChIKey is GAONTFIHHDQVLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21N3O4S2/c24-16-9-8-15(23-17(25)13-6-2-3-7-14(13)18(23)26)19(27)22(16)12-29-20(28)21-10-4-1-5-11-21/h2-3,6-7,15H,1,4-5,8-12H2.
What are the key properties of [3-(1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]methyl piperidine-1-carbodithioate?
[3-(1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]methyl piperidine-1-carbodithioate has a molecular weight of 431.54 g/mol, XLogP of 2.26, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]methyl piperidine-1-carbodithioate is sourced from PubChem (CID 44588398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).