C8H16O4S — CID 44588422
(2S,3R,4S,5R)-2-propylsulfanyloxane-3,4,5-triol (PubChem CID 44588422) has the molecular formula C8H16O4S and a molecular weight of 208.28 g/mol. Its IUPAC name is (2S,3R,4S,5R)-2-propylsulfanyloxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5R)-2-propylsulfanyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 44588422 |
| Molecular Formula | C8H16O4S |
| Molecular Weight | 208.28 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | (2S,3R,4S,5R)-2-propylsulfanyloxane-3,4,5-triol |
| SMILES | CCCS[C@@H]1OC[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C8H16O4S/c1-2-3-13-8-7(11)6(10)5(9)4-12-8/h5-11H,2-4H2,1H3/t5-,6+,7-,8+/m1/s1 |
| InChIKey | BFQAMGXXQARPNW-CWKFCGSDSA-N |
| XLogP | -0.43 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.28 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |