C21H24O6 — CID 44588456
(4R,4aS,8aR)-4-(dimethoxymethyl)-2,6-diphenyl-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxine (PubChem CID 44588456) has the molecular formula C21H24O6 and a molecular weight of 372.42 g/mol. Its IUPAC name is (4R,4aS,8aR)-4-(dimethoxymethyl)-2,6-diphenyl-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxine.
| Compound Name | (4R,4aS,8aR)-4-(dimethoxymethyl)-2,6-diphenyl-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxine |
|---|---|
| PubChem CID | 44588456 |
| Molecular Formula | C21H24O6 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | (4R,4aS,8aR)-4-(dimethoxymethyl)-2,6-diphenyl-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxine |
| SMILES | COC(OC)[C@@H]1OC(c2ccccc2)O[C@@H]2COC(c3ccccc3)O[C@@H]21 |
| InChI | InChI=1S/C21H24O6/c1-22-21(23-2)18-17-16(25-20(27-18)15-11-7-4-8-12-15)13-24-19(26-17)14-9-5-3-6-10-14/h3-12,16-21H,13H2,1-2H3/t16-,17+,18-,19?,20?/m1/s1 |
| InChIKey | APHZFPITYCSKIN-HUFQQLBRSA-N |
| XLogP | 3.20 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|