About N-methyl-1-(3-tricyclo[3.3.1.03,7]nonanyl)methanamine
N-methyl-1-(3-tricyclo[3.3.1.03,7]nonanyl)methanamine (PubChem CID 44588536) has the molecular formula C11H19N
and a molecular weight of 165.28 g/mol. Its IUPAC name is N-methyl-1-(3-tricyclo[3.3.1.03,7]nonanyl)methanamine.
Molecular Properties
| Compound Name | N-methyl-1-(3-tricyclo[3.3.1.03,7]nonanyl)methanamine |
| PubChem CID | 44588536 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | N-methyl-1-(3-tricyclo[3.3.1.03,7]nonanyl)methanamine |
| SMILES | CNCC12CC3CC(CC1C3)C2 |
| InChI | InChI=1S/C11H19N/c1-12-7-11-5-8-2-9(6-11)4-10(11)3-8/h8-10,12H,2-7H2,1H3 |
| InChIKey | AUQHHONRNXPYQM-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-methyl-1-(3-tricyclo[3.3.1.03,7]nonanyl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-1-(3-tricyclo[3.3.1.03,7]nonanyl)methanamine?
The IUPAC name of N-methyl-1-(3-tricyclo[3.3.1.03,7]nonanyl)methanamine (CID 44588536) is N-methyl-1-(3-tricyclo[3.3.1.03,7]nonanyl)methanamine.
What is the SMILES notation for N-methyl-1-(3-tricyclo[3.3.1.03,7]nonanyl)methanamine?
The canonical SMILES for N-methyl-1-(3-tricyclo[3.3.1.03,7]nonanyl)methanamine is CNCC12CC3CC(CC1C3)C2.
What is the InChIKey of N-methyl-1-(3-tricyclo[3.3.1.03,7]nonanyl)methanamine?
The InChIKey is AUQHHONRNXPYQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N/c1-12-7-11-5-8-2-9(6-11)4-10(11)3-8/h8-10,12H,2-7H2,1H3.
What are the key properties of N-methyl-1-(3-tricyclo[3.3.1.03,7]nonanyl)methanamine?
N-methyl-1-(3-tricyclo[3.3.1.03,7]nonanyl)methanamine has a molecular weight of 165.28 g/mol, XLogP of 2.03, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-1-(3-tricyclo[3.3.1.03,7]nonanyl)methanamine is sourced from PubChem (CID 44588536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).