C32H54O5 — CID 44588906
(2S,3S,4R,7S,9S,10R,11S,12Z,14S,16S,17S,18E,20Z)-2-[(2S,3Z)-hexa-3,5-dien-2-yl]-3,7,9,11,17-pentamethyl-1-oxacyclodocosa-12,18,20-triene-4,10,14,16-tetrol (PubChem CID 44588906) has the molecular formula C32H54O5 and a molecular weight of 518.78 g/mol. Its IUPAC name is (2S,3S,4R,7S,9S,10R,11S,12Z,14S,16S,17S,18E,20Z)-2-[(2S,3Z)-hexa-3,5-dien-2-yl]-3,7,9,11,17-pentamethyl-1-oxacyclodocosa-12,18,20-triene-4,10,14,16-tetrol.
| Compound Name | (2S,3S,4R,7S,9S,10R,11S,12Z,14S,16S,17S,18E,20Z)-2-[(2S,3Z)-hexa-3,5-dien-2-yl]-3,7,9,11,17-pentamethyl-1-oxacyclodocosa-12,18,20-triene-4,10,14,16-tetrol |
|---|---|
| PubChem CID | 44588906 |
| Molecular Formula | C32H54O5 |
| Molecular Weight | 518.78 g/mol |
| Exact Mass | 518.40 |
| IUPAC Name | (2S,3S,4R,7S,9S,10R,11S,12Z,14S,16S,17S,18E,20Z)-2-[(2S,3Z)-hexa-3,5-dien-2-yl]-3,7,9,11,17-pentamethyl-1-oxacyclodocosa-12,18,20-triene-4,10,14,16-tetrol |
| SMILES | C=C/C=C\[C@H](C)[C@@H]1OC/C=C\C=C\[C@H](C)[C@@H](O)C[C@H](O)/C=C\[C@H](C)[C@H](O)[C@@H](C)C[C@@H](C)CC[C@@H](O)[C@@H]1C |
| InChI | InChI=1S/C32H54O5/c1-8-9-13-25(5)32-27(7)29(34)18-15-22(2)20-26(6)31(36)24(4)16-17-28(33)21-30(35)23(3)14-11-10-12-19-37-32/h8-14,16-17,22-36H,1,15,18-21H2,2-7H3/b12-10-,13-9-,14-11+,17-16-/t22-,23-,24-,25-,26-,27-,28+,29+,30-,31-,32-/m0/s1 |
| InChIKey | NRHVUOWILUSQEU-AGSHSIGGSA-N |
| XLogP | 5.62 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.78 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|