C25H28BrNO2 — CID 44588957
3-methyl-5,9-bis(3-methylphenyl)-1,2,4,5-tetrahydro-3-benzazepine-7,8-diol;hydrobromide (PubChem CID 44588957) has the molecular formula C25H28BrNO2 and a molecular weight of 454.41 g/mol. Its IUPAC name is 3-methyl-5,9-bis(3-methylphenyl)-1,2,4,5-tetrahydro-3-benzazepine-7,8-diol;hydrobromide.
| Compound Name | 3-methyl-5,9-bis(3-methylphenyl)-1,2,4,5-tetrahydro-3-benzazepine-7,8-diol;hydrobromide |
|---|---|
| PubChem CID | 44588957 |
| Molecular Formula | C25H28BrNO2 |
| Molecular Weight | 454.41 g/mol |
| Exact Mass | 453.13 |
| IUPAC Name | 3-methyl-5,9-bis(3-methylphenyl)-1,2,4,5-tetrahydro-3-benzazepine-7,8-diol;hydrobromide |
| SMILES | Br.Cc1cccc(-c2c(O)c(O)cc3c2CCN(C)CC3c2cccc(C)c2)c1 |
| InChI | InChI=1S/C25H27NO2.BrH/c1-16-6-4-8-18(12-16)22-15-26(3)11-10-20-21(22)14-23(27)25(28)24(20)19-9-5-7-17(2)13-19;/h4-9,12-14,22,27-28H,10-11,15H2,1-3H3;1H |
| InChIKey | WKXBRVOJFDBSLP-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.41 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|