About N',N'-dimethyl-N-[2-[4-(4-methylpiperazin-1-yl)phenyl]quinazolin-4-yl]ethane-1,2-diamine
N',N'-dimethyl-N-[2-[4-(4-methylpiperazin-1-yl)phenyl]quinazolin-4-yl]ethane-1,2-diamine (PubChem CID 44589026) has the molecular formula C23H30N6
and a molecular weight of 390.54 g/mol. Its IUPAC name is N',N'-dimethyl-N-[2-[4-(4-methylpiperazin-1-yl)phenyl]quinazolin-4-yl]ethane-1,2-diamine.
Molecular Properties
| Compound Name | N',N'-dimethyl-N-[2-[4-(4-methylpiperazin-1-yl)phenyl]quinazolin-4-yl]ethane-1,2-diamine |
| PubChem CID | 44589026 |
| Molecular Formula | C23H30N6 |
| Molecular Weight | 390.54 g/mol |
| Exact Mass | 390.25 |
| IUPAC Name | N',N'-dimethyl-N-[2-[4-(4-methylpiperazin-1-yl)phenyl]quinazolin-4-yl]ethane-1,2-diamine |
| SMILES | CN(C)CCNc1nc(-c2ccc(N3CCN(C)CC3)cc2)nc2ccccc12 |
| InChI | InChI=1S/C23H30N6/c1-27(2)13-12-24-23-20-6-4-5-7-21(20)25-22(26-23)18-8-10-19(11-9-18)29-16-14-28(3)15-17-29/h4-11H,12-17H2,1-3H3,(H,24,25,26) |
| InChIKey | QYSDZDWFJBQSFW-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 47.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.54 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N',N'-dimethyl-N-[2-[4-(4-methylpiperazin-1-yl)phenyl]quinazolin-4-yl]ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N',N'-dimethyl-N-[2-[4-(4-methylpiperazin-1-yl)phenyl]quinazolin-4-yl]ethane-1,2-diamine?
The IUPAC name of N',N'-dimethyl-N-[2-[4-(4-methylpiperazin-1-yl)phenyl]quinazolin-4-yl]ethane-1,2-diamine (CID 44589026) is N',N'-dimethyl-N-[2-[4-(4-methylpiperazin-1-yl)phenyl]quinazolin-4-yl]ethane-1,2-diamine.
What is the SMILES notation for N',N'-dimethyl-N-[2-[4-(4-methylpiperazin-1-yl)phenyl]quinazolin-4-yl]ethane-1,2-diamine?
The canonical SMILES for N',N'-dimethyl-N-[2-[4-(4-methylpiperazin-1-yl)phenyl]quinazolin-4-yl]ethane-1,2-diamine is CN(C)CCNc1nc(-c2ccc(N3CCN(C)CC3)cc2)nc2ccccc12.
What is the InChIKey of N',N'-dimethyl-N-[2-[4-(4-methylpiperazin-1-yl)phenyl]quinazolin-4-yl]ethane-1,2-diamine?
The InChIKey is QYSDZDWFJBQSFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H30N6/c1-27(2)13-12-24-23-20-6-4-5-7-21(20)25-22(26-23)18-8-10-19(11-9-18)29-16-14-28(3)15-17-29/h4-11H,12-17H2,1-3H3,(H,24,25,26).
What are the key properties of N',N'-dimethyl-N-[2-[4-(4-methylpiperazin-1-yl)phenyl]quinazolin-4-yl]ethane-1,2-diamine?
N',N'-dimethyl-N-[2-[4-(4-methylpiperazin-1-yl)phenyl]quinazolin-4-yl]ethane-1,2-diamine has a molecular weight of 390.54 g/mol, XLogP of 3.02, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N',N'-dimethyl-N-[2-[4-(4-methylpiperazin-1-yl)phenyl]quinazolin-4-yl]ethane-1,2-diamine is sourced from PubChem (CID 44589026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).