About 1-[(1-benzyl-3,4-dihydro-2H-quinolin-6-yl)oxy]-3-(propan-2-ylamino)propan-2-ol
1-[(1-benzyl-3,4-dihydro-2H-quinolin-6-yl)oxy]-3-(propan-2-ylamino)propan-2-ol (PubChem CID 44589133) has the molecular formula C22H30N2O2
and a molecular weight of 354.49 g/mol. Its IUPAC name is 1-[(1-benzyl-3,4-dihydro-2H-quinolin-6-yl)oxy]-3-(propan-2-ylamino)propan-2-ol.
Molecular Properties
| Compound Name | 1-[(1-benzyl-3,4-dihydro-2H-quinolin-6-yl)oxy]-3-(propan-2-ylamino)propan-2-ol |
| PubChem CID | 44589133 |
| Molecular Formula | C22H30N2O2 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.23 |
| IUPAC Name | 1-[(1-benzyl-3,4-dihydro-2H-quinolin-6-yl)oxy]-3-(propan-2-ylamino)propan-2-ol |
| SMILES | CC(C)NCC(O)COc1ccc2c(c1)CCCN2Cc1ccccc1 |
| InChI | InChI=1S/C22H30N2O2/c1-17(2)23-14-20(25)16-26-21-10-11-22-19(13-21)9-6-12-24(22)15-18-7-4-3-5-8-18/h3-5,7-8,10-11,13,17,20,23,25H,6,9,12,14-16H2,1-2H3 |
| InChIKey | JUVWASPQEPNQTK-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze 1-[(1-benzyl-3,4-dihydro-2H-quinolin-6-yl)oxy]-3-(propan-2-ylamino)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1-benzyl-3,4-dihydro-2H-quinolin-6-yl)oxy]-3-(propan-2-ylamino)propan-2-ol?
The IUPAC name of 1-[(1-benzyl-3,4-dihydro-2H-quinolin-6-yl)oxy]-3-(propan-2-ylamino)propan-2-ol (CID 44589133) is 1-[(1-benzyl-3,4-dihydro-2H-quinolin-6-yl)oxy]-3-(propan-2-ylamino)propan-2-ol.
What is the SMILES notation for 1-[(1-benzyl-3,4-dihydro-2H-quinolin-6-yl)oxy]-3-(propan-2-ylamino)propan-2-ol?
The canonical SMILES for 1-[(1-benzyl-3,4-dihydro-2H-quinolin-6-yl)oxy]-3-(propan-2-ylamino)propan-2-ol is CC(C)NCC(O)COc1ccc2c(c1)CCCN2Cc1ccccc1.
What is the InChIKey of 1-[(1-benzyl-3,4-dihydro-2H-quinolin-6-yl)oxy]-3-(propan-2-ylamino)propan-2-ol?
The InChIKey is JUVWASPQEPNQTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H30N2O2/c1-17(2)23-14-20(25)16-26-21-10-11-22-19(13-21)9-6-12-24(22)15-18-7-4-3-5-8-18/h3-5,7-8,10-11,13,17,20,23,25H,6,9,12,14-16H2,1-2H3.
What are the key properties of 1-[(1-benzyl-3,4-dihydro-2H-quinolin-6-yl)oxy]-3-(propan-2-ylamino)propan-2-ol?
1-[(1-benzyl-3,4-dihydro-2H-quinolin-6-yl)oxy]-3-(propan-2-ylamino)propan-2-ol has a molecular weight of 354.49 g/mol, XLogP of 3.38, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1-benzyl-3,4-dihydro-2H-quinolin-6-yl)oxy]-3-(propan-2-ylamino)propan-2-ol is sourced from PubChem (CID 44589133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).