C22H30N2O4 — CID 44589139
1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-(1,2,3,4-tetrahydroquinolin-6-yloxy)propan-2-ol (PubChem CID 44589139) has the molecular formula C22H30N2O4 and a molecular weight of 386.49 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-(1,2,3,4-tetrahydroquinolin-6-yloxy)propan-2-ol.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-(1,2,3,4-tetrahydroquinolin-6-yloxy)propan-2-ol |
|---|---|
| PubChem CID | 44589139 |
| Molecular Formula | C22H30N2O4 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-(1,2,3,4-tetrahydroquinolin-6-yloxy)propan-2-ol |
| SMILES | COc1ccc(CCNCC(O)COc2ccc3c(c2)CCCN3)cc1OC |
| InChI | InChI=1S/C22H30N2O4/c1-26-21-8-5-16(12-22(21)27-2)9-11-23-14-18(25)15-28-19-6-7-20-17(13-19)4-3-10-24-20/h5-8,12-13,18,23-25H,3-4,9-11,14-15H2,1-2H3 |
| InChIKey | APXBKQSWPZDMQL-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 71.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|