About 2-cyclohexylsulfanyl-1,3-dinitro-5-(trifluoromethyl)benzene
2-cyclohexylsulfanyl-1,3-dinitro-5-(trifluoromethyl)benzene (PubChem CID 44589158) has the molecular formula C13H13F3N2O4S
and a molecular weight of 350.32 g/mol. Its IUPAC name is 2-cyclohexylsulfanyl-1,3-dinitro-5-(trifluoromethyl)benzene.
Molecular Properties
| Compound Name | 2-cyclohexylsulfanyl-1,3-dinitro-5-(trifluoromethyl)benzene |
| PubChem CID | 44589158 |
| Molecular Formula | C13H13F3N2O4S |
| Molecular Weight | 350.32 g/mol |
| Exact Mass | 350.05 |
| IUPAC Name | 2-cyclohexylsulfanyl-1,3-dinitro-5-(trifluoromethyl)benzene |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)cc([N+](=O)[O-])c1SC1CCCCC1 |
| InChI | InChI=1S/C13H13F3N2O4S/c14-13(15,16)8-6-10(17(19)20)12(11(7-8)18(21)22)23-9-4-2-1-3-5-9/h6-7,9H,1-5H2 |
| InChIKey | SXGNKJXSOZMJRS-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.32 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclohexylsulfanyl-1,3-dinitro-5-(trifluoromethyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexylsulfanyl-1,3-dinitro-5-(trifluoromethyl)benzene?
The IUPAC name of 2-cyclohexylsulfanyl-1,3-dinitro-5-(trifluoromethyl)benzene (CID 44589158) is 2-cyclohexylsulfanyl-1,3-dinitro-5-(trifluoromethyl)benzene.
What is the SMILES notation for 2-cyclohexylsulfanyl-1,3-dinitro-5-(trifluoromethyl)benzene?
The canonical SMILES for 2-cyclohexylsulfanyl-1,3-dinitro-5-(trifluoromethyl)benzene is O=[N+]([O-])c1cc(C(F)(F)F)cc([N+](=O)[O-])c1SC1CCCCC1.
What is the InChIKey of 2-cyclohexylsulfanyl-1,3-dinitro-5-(trifluoromethyl)benzene?
The InChIKey is SXGNKJXSOZMJRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13F3N2O4S/c14-13(15,16)8-6-10(17(19)20)12(11(7-8)18(21)22)23-9-4-2-1-3-5-9/h6-7,9H,1-5H2.
What are the key properties of 2-cyclohexylsulfanyl-1,3-dinitro-5-(trifluoromethyl)benzene?
2-cyclohexylsulfanyl-1,3-dinitro-5-(trifluoromethyl)benzene has a molecular weight of 350.32 g/mol, XLogP of 4.95, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexylsulfanyl-1,3-dinitro-5-(trifluoromethyl)benzene is sourced from PubChem (CID 44589158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).