C22H27N5O3 — CID 44589176
N-[4-[4-(4-methoxyphenyl)piperazin-1-yl]butyl]-2,1,3-benzoxadiazole-5-carboxamide (PubChem CID 44589176) has the molecular formula C22H27N5O3 and a molecular weight of 409.49 g/mol. Its IUPAC name is N-[4-[4-(4-methoxyphenyl)piperazin-1-yl]butyl]-2,1,3-benzoxadiazole-5-carboxamide.
| Compound Name | N-[4-[4-(4-methoxyphenyl)piperazin-1-yl]butyl]-2,1,3-benzoxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 44589176 |
| Molecular Formula | C22H27N5O3 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | N-[4-[4-(4-methoxyphenyl)piperazin-1-yl]butyl]-2,1,3-benzoxadiazole-5-carboxamide |
| SMILES | COc1ccc(N2CCN(CCCCNC(=O)c3ccc4nonc4c3)CC2)cc1 |
| InChI | InChI=1S/C22H27N5O3/c1-29-19-7-5-18(6-8-19)27-14-12-26(13-15-27)11-3-2-10-23-22(28)17-4-9-20-21(16-17)25-30-24-20/h4-9,16H,2-3,10-15H2,1H3,(H,23,28) |
| InChIKey | DDFNIAVTIHLFOR-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 83.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|