About (Z)-1-([1,3]oxazolo[5,4-b]pyridin-2-yl)heptadec-8-en-1-one
(Z)-1-([1,3]oxazolo[5,4-b]pyridin-2-yl)heptadec-8-en-1-one (PubChem CID 44589336) has the molecular formula C23H34N2O2
and a molecular weight of 370.54 g/mol. Its IUPAC name is (Z)-1-([1,3]oxazolo[5,4-b]pyridin-2-yl)heptadec-8-en-1-one.
Molecular Properties
| Compound Name | (Z)-1-([1,3]oxazolo[5,4-b]pyridin-2-yl)heptadec-8-en-1-one |
| PubChem CID | 44589336 |
| Molecular Formula | C23H34N2O2 |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.26 |
| IUPAC Name | (Z)-1-([1,3]oxazolo[5,4-b]pyridin-2-yl)heptadec-8-en-1-one |
| SMILES | CCCCCCCC/C=C\CCCCCCC(=O)c1nc2cccnc2o1 |
| InChI | InChI=1S/C23H34N2O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-18-21(26)23-25-20-17-16-19-24-22(20)27-23/h9-10,16-17,19H,2-8,11-15,18H2,1H3/b10-9- |
| InChIKey | RYPJWJOEKZWVES-KTKRTIGZSA-N |
| XLogP | 7.05 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-1-([1,3]oxazolo[5,4-b]pyridin-2-yl)heptadec-8-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1-([1,3]oxazolo[5,4-b]pyridin-2-yl)heptadec-8-en-1-one?
The IUPAC name of (Z)-1-([1,3]oxazolo[5,4-b]pyridin-2-yl)heptadec-8-en-1-one (CID 44589336) is (Z)-1-([1,3]oxazolo[5,4-b]pyridin-2-yl)heptadec-8-en-1-one.
What is the SMILES notation for (Z)-1-([1,3]oxazolo[5,4-b]pyridin-2-yl)heptadec-8-en-1-one?
The canonical SMILES for (Z)-1-([1,3]oxazolo[5,4-b]pyridin-2-yl)heptadec-8-en-1-one is CCCCCCCC/C=C\CCCCCCC(=O)c1nc2cccnc2o1.
What is the InChIKey of (Z)-1-([1,3]oxazolo[5,4-b]pyridin-2-yl)heptadec-8-en-1-one?
The InChIKey is RYPJWJOEKZWVES-KTKRTIGZSA-N. The full InChI is InChI=1S/C23H34N2O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-18-21(26)23-25-20-17-16-19-24-22(20)27-23/h9-10,16-17,19H,2-8,11-15,18H2,1H3/b10-9-.
What are the key properties of (Z)-1-([1,3]oxazolo[5,4-b]pyridin-2-yl)heptadec-8-en-1-one?
(Z)-1-([1,3]oxazolo[5,4-b]pyridin-2-yl)heptadec-8-en-1-one has a molecular weight of 370.54 g/mol, XLogP of 7.05, 15 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1-([1,3]oxazolo[5,4-b]pyridin-2-yl)heptadec-8-en-1-one is sourced from PubChem (CID 44589336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).