About 3-(dimethylamino)butyl piperidine-1-carboxylate
3-(dimethylamino)butyl piperidine-1-carboxylate (PubChem CID 44589438) has the molecular formula C12H24N2O2
and a molecular weight of 228.34 g/mol. Its IUPAC name is 3-(dimethylamino)butyl piperidine-1-carboxylate.
Molecular Properties
| Compound Name | 3-(dimethylamino)butyl piperidine-1-carboxylate |
| PubChem CID | 44589438 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | 3-(dimethylamino)butyl piperidine-1-carboxylate |
| SMILES | CC(CCOC(=O)N1CCCCC1)N(C)C |
| InChI | InChI=1S/C12H24N2O2/c1-11(13(2)3)7-10-16-12(15)14-8-5-4-6-9-14/h11H,4-10H2,1-3H3 |
| InChIKey | BVDJUTIKRAZUNH-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(dimethylamino)butyl piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(dimethylamino)butyl piperidine-1-carboxylate?
The IUPAC name of 3-(dimethylamino)butyl piperidine-1-carboxylate (CID 44589438) is 3-(dimethylamino)butyl piperidine-1-carboxylate.
What is the SMILES notation for 3-(dimethylamino)butyl piperidine-1-carboxylate?
The canonical SMILES for 3-(dimethylamino)butyl piperidine-1-carboxylate is CC(CCOC(=O)N1CCCCC1)N(C)C.
What is the InChIKey of 3-(dimethylamino)butyl piperidine-1-carboxylate?
The InChIKey is BVDJUTIKRAZUNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2O2/c1-11(13(2)3)7-10-16-12(15)14-8-5-4-6-9-14/h11H,4-10H2,1-3H3.
What are the key properties of 3-(dimethylamino)butyl piperidine-1-carboxylate?
3-(dimethylamino)butyl piperidine-1-carboxylate has a molecular weight of 228.34 g/mol, XLogP of 1.95, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(dimethylamino)butyl piperidine-1-carboxylate is sourced from PubChem (CID 44589438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).