C23H24N6O2S — CID 44589520
N-(2-amino-5-thiophen-2-ylphenyl)-6-(2-oxo-1,3,8-triazaspiro[4.5]decan-8-yl)pyridine-3-carboxamide (PubChem CID 44589520) has the molecular formula C23H24N6O2S and a molecular weight of 448.55 g/mol. Its IUPAC name is N-(2-amino-5-thiophen-2-ylphenyl)-6-(2-oxo-1,3,8-triazaspiro[4.5]decan-8-yl)pyridine-3-carboxamide.
| Compound Name | N-(2-amino-5-thiophen-2-ylphenyl)-6-(2-oxo-1,3,8-triazaspiro[4.5]decan-8-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 44589520 |
| Molecular Formula | C23H24N6O2S |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | N-(2-amino-5-thiophen-2-ylphenyl)-6-(2-oxo-1,3,8-triazaspiro[4.5]decan-8-yl)pyridine-3-carboxamide |
| SMILES | Nc1ccc(-c2cccs2)cc1NC(=O)c1ccc(N2CCC3(CC2)CNC(=O)N3)nc1 |
| InChI | InChI=1S/C23H24N6O2S/c24-17-5-3-15(19-2-1-11-32-19)12-18(17)27-21(30)16-4-6-20(25-13-16)29-9-7-23(8-10-29)14-26-22(31)28-23/h1-6,11-13H,7-10,14,24H2,(H,27,30)(H2,26,28,31) |
| InChIKey | PCLVYCVVWYEUSB-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 112.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|