C23H23N7O — CID 44589649
2-N-[2-(4-aminophenyl)ethyl]-5-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)-4-N-phenylpyrimidine-2,4-diamine (PubChem CID 44589649) has the molecular formula C23H23N7O and a molecular weight of 413.49 g/mol. Its IUPAC name is 2-N-[2-(4-aminophenyl)ethyl]-5-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)-4-N-phenylpyrimidine-2,4-diamine.
| Compound Name | 2-N-[2-(4-aminophenyl)ethyl]-5-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)-4-N-phenylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 44589649 |
| Molecular Formula | C23H23N7O |
| Molecular Weight | 413.49 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | 2-N-[2-(4-aminophenyl)ethyl]-5-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)-4-N-phenylpyrimidine-2,4-diamine |
| SMILES | Nc1ccc(CCNc2ncc(-c3nnc(C4CC4)o3)c(Nc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C23H23N7O/c24-17-10-6-15(7-11-17)12-13-25-23-26-14-19(22-30-29-21(31-22)16-8-9-16)20(28-23)27-18-4-2-1-3-5-18/h1-7,10-11,14,16H,8-9,12-13,24H2,(H2,25,26,27,28) |
| InChIKey | XZJFJRSTHAEXOF-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 114.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.49 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|