About [(2R)-3-methyl-1-[5-(trifluoromethyl)pyrazol-1-yl]butan-2-yl] N-(2,4-difluorophenyl)carbamate
[(2R)-3-methyl-1-[5-(trifluoromethyl)pyrazol-1-yl]butan-2-yl] N-(2,4-difluorophenyl)carbamate (PubChem CID 44589740) has the molecular formula C16H16F5N3O2
and a molecular weight of 377.31 g/mol. Its IUPAC name is [(2R)-3-methyl-1-[5-(trifluoromethyl)pyrazol-1-yl]butan-2-yl] N-(2,4-difluorophenyl)carbamate.
Molecular Properties
| Compound Name | [(2R)-3-methyl-1-[5-(trifluoromethyl)pyrazol-1-yl]butan-2-yl] N-(2,4-difluorophenyl)carbamate |
| PubChem CID | 44589740 |
| Molecular Formula | C16H16F5N3O2 |
| Molecular Weight | 377.31 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | [(2R)-3-methyl-1-[5-(trifluoromethyl)pyrazol-1-yl]butan-2-yl] N-(2,4-difluorophenyl)carbamate |
| SMILES | CC(C)[C@H](Cn1nccc1C(F)(F)F)OC(=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C16H16F5N3O2/c1-9(2)13(8-24-14(5-6-22-24)16(19,20)21)26-15(25)23-12-4-3-10(17)7-11(12)18/h3-7,9,13H,8H2,1-2H3,(H,23,25)/t13-/m0/s1 |
| InChIKey | VNYDKXNMOJUENE-ZDUSSCGKSA-N |
| XLogP | 4.45 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.31 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(2R)-3-methyl-1-[5-(trifluoromethyl)pyrazol-1-yl]butan-2-yl] N-(2,4-difluorophenyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-3-methyl-1-[5-(trifluoromethyl)pyrazol-1-yl]butan-2-yl] N-(2,4-difluorophenyl)carbamate?
The IUPAC name of [(2R)-3-methyl-1-[5-(trifluoromethyl)pyrazol-1-yl]butan-2-yl] N-(2,4-difluorophenyl)carbamate (CID 44589740) is [(2R)-3-methyl-1-[5-(trifluoromethyl)pyrazol-1-yl]butan-2-yl] N-(2,4-difluorophenyl)carbamate.
What is the SMILES notation for [(2R)-3-methyl-1-[5-(trifluoromethyl)pyrazol-1-yl]butan-2-yl] N-(2,4-difluorophenyl)carbamate?
The canonical SMILES for [(2R)-3-methyl-1-[5-(trifluoromethyl)pyrazol-1-yl]butan-2-yl] N-(2,4-difluorophenyl)carbamate is CC(C)[C@H](Cn1nccc1C(F)(F)F)OC(=O)Nc1ccc(F)cc1F.
What is the InChIKey of [(2R)-3-methyl-1-[5-(trifluoromethyl)pyrazol-1-yl]butan-2-yl] N-(2,4-difluorophenyl)carbamate?
The InChIKey is VNYDKXNMOJUENE-ZDUSSCGKSA-N. The full InChI is InChI=1S/C16H16F5N3O2/c1-9(2)13(8-24-14(5-6-22-24)16(19,20)21)26-15(25)23-12-4-3-10(17)7-11(12)18/h3-7,9,13H,8H2,1-2H3,(H,23,25)/t13-/m0/s1.
What are the key properties of [(2R)-3-methyl-1-[5-(trifluoromethyl)pyrazol-1-yl]butan-2-yl] N-(2,4-difluorophenyl)carbamate?
[(2R)-3-methyl-1-[5-(trifluoromethyl)pyrazol-1-yl]butan-2-yl] N-(2,4-difluorophenyl)carbamate has a molecular weight of 377.31 g/mol, XLogP of 4.45, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-3-methyl-1-[5-(trifluoromethyl)pyrazol-1-yl]butan-2-yl] N-(2,4-difluorophenyl)carbamate is sourced from PubChem (CID 44589740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).