C38H48N8O5 — CID 44589769
(6S,9R,12S)-12-(4-aminobutyl)-6-benzyl-9-(1H-indol-3-ylmethyl)-23-methyl-5,8,11,14,20,22-hexazabicyclo[17.2.2]tricosa-1(22),19(23)-diene-4,7,10,13,21-pentone (PubChem CID 44589769) has the molecular formula C38H48N8O5 and a molecular weight of 696.85 g/mol. Its IUPAC name is (6S,9R,12S)-12-(4-aminobutyl)-6-benzyl-9-(1H-indol-3-ylmethyl)-23-methyl-5,8,11,14,20,22-hexazabicyclo[17.2.2]tricosa-1(22),19(23)-diene-4,7,10,13,21-pentone.
| Compound Name | (6S,9R,12S)-12-(4-aminobutyl)-6-benzyl-9-(1H-indol-3-ylmethyl)-23-methyl-5,8,11,14,20,22-hexazabicyclo[17.2.2]tricosa-1(22),19(23)-diene-4,7,10,13,21-pentone |
|---|---|
| PubChem CID | 44589769 |
| Molecular Formula | C38H48N8O5 |
| Molecular Weight | 696.85 g/mol |
| Exact Mass | 696.37 |
| IUPAC Name | (6S,9R,12S)-12-(4-aminobutyl)-6-benzyl-9-(1H-indol-3-ylmethyl)-23-methyl-5,8,11,14,20,22-hexazabicyclo[17.2.2]tricosa-1(22),19(23)-diene-4,7,10,13,21-pentone |
| SMILES | Cc1nc2c(=O)[nH]c1CCCCNC(=O)[C@H](CCCCN)NC(=O)[C@@H](Cc1c[nH]c3ccccc13)NC(=O)[C@H](Cc1ccccc1)NC(=O)CC2 |
| InChI | InChI=1S/C38H48N8O5/c1-24-28-14-8-10-20-40-35(48)30(16-7-9-19-39)45-38(51)33(22-26-23-41-29-15-6-5-13-27(26)29)46-37(50)32(21-25-11-3-2-4-12-25)43-34(47)18-17-31(42-24)36(49)44-28/h2-6,11-13,15,23,30,32-33,41H,7-10,14,16-22,39H2,1H3,(H,40,48)(H,43,47)(H,44,49)(H,45,51)(H,46,50)/t30-,32-,33+/m0/s1 |
| InChIKey | XBXULXTXMYBPLE-FLPLPDKSSA-N |
| XLogP | 2.01 |
| TPSA | 203.96 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.85 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'crown_ether', 'substructure': 'N/A'} |
|---|