C27H31N7OS — CID 44589905
4-[(2-amino-1,3-benzothiazol-6-yl)amino]-7-[3-(3,5-dimethylpiperazin-1-yl)propoxy]-6-methylquinoline-3-carbonitrile (PubChem CID 44589905) has the molecular formula C27H31N7OS and a molecular weight of 501.66 g/mol. Its IUPAC name is 4-[(2-amino-1,3-benzothiazol-6-yl)amino]-7-[3-(3,5-dimethylpiperazin-1-yl)propoxy]-6-methylquinoline-3-carbonitrile.
| Compound Name | 4-[(2-amino-1,3-benzothiazol-6-yl)amino]-7-[3-(3,5-dimethylpiperazin-1-yl)propoxy]-6-methylquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 44589905 |
| Molecular Formula | C27H31N7OS |
| Molecular Weight | 501.66 g/mol |
| Exact Mass | 501.23 |
| IUPAC Name | 4-[(2-amino-1,3-benzothiazol-6-yl)amino]-7-[3-(3,5-dimethylpiperazin-1-yl)propoxy]-6-methylquinoline-3-carbonitrile |
| SMILES | Cc1cc2c(Nc3ccc4nc(N)sc4c3)c(C#N)cnc2cc1OCCCN1CC(C)NC(C)C1 |
| InChI | InChI=1S/C27H31N7OS/c1-16-9-21-23(11-24(16)35-8-4-7-34-14-17(2)31-18(3)15-34)30-13-19(12-28)26(21)32-20-5-6-22-25(10-20)36-27(29)33-22/h5-6,9-11,13,17-18,31H,4,7-8,14-15H2,1-3H3,(H2,29,33)(H,30,32) |
| InChIKey | PCCKFKMSYUVHFC-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 112.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.66 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|