About (3R)-3-amino-N-(1,1-dioxo-4-pyridin-2-ylthian-4-yl)-4-(2-fluorophenyl)butanamide
(3R)-3-amino-N-(1,1-dioxo-4-pyridin-2-ylthian-4-yl)-4-(2-fluorophenyl)butanamide (PubChem CID 44589934) has the molecular formula C20H24FN3O3S
and a molecular weight of 405.50 g/mol. Its IUPAC name is (3R)-3-amino-N-(1,1-dioxo-4-pyridin-2-ylthian-4-yl)-4-(2-fluorophenyl)butanamide.
Molecular Properties
| Compound Name | (3R)-3-amino-N-(1,1-dioxo-4-pyridin-2-ylthian-4-yl)-4-(2-fluorophenyl)butanamide |
| PubChem CID | 44589934 |
| Molecular Formula | C20H24FN3O3S |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | (3R)-3-amino-N-(1,1-dioxo-4-pyridin-2-ylthian-4-yl)-4-(2-fluorophenyl)butanamide |
| SMILES | N[C@@H](CC(=O)NC1(c2ccccn2)CCS(=O)(=O)CC1)Cc1ccccc1F |
| InChI | InChI=1S/C20H24FN3O3S/c21-17-6-2-1-5-15(17)13-16(22)14-19(25)24-20(18-7-3-4-10-23-18)8-11-28(26,27)12-9-20/h1-7,10,16H,8-9,11-14,22H2,(H,24,25)/t16-/m1/s1 |
| InChIKey | KRZBFUVKDUANHY-MRXNPFEDSA-N |
| XLogP | 1.70 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3R)-3-amino-N-(1,1-dioxo-4-pyridin-2-ylthian-4-yl)-4-(2-fluorophenyl)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-amino-N-(1,1-dioxo-4-pyridin-2-ylthian-4-yl)-4-(2-fluorophenyl)butanamide?
The IUPAC name of (3R)-3-amino-N-(1,1-dioxo-4-pyridin-2-ylthian-4-yl)-4-(2-fluorophenyl)butanamide (CID 44589934) is (3R)-3-amino-N-(1,1-dioxo-4-pyridin-2-ylthian-4-yl)-4-(2-fluorophenyl)butanamide.
What is the SMILES notation for (3R)-3-amino-N-(1,1-dioxo-4-pyridin-2-ylthian-4-yl)-4-(2-fluorophenyl)butanamide?
The canonical SMILES for (3R)-3-amino-N-(1,1-dioxo-4-pyridin-2-ylthian-4-yl)-4-(2-fluorophenyl)butanamide is N[C@@H](CC(=O)NC1(c2ccccn2)CCS(=O)(=O)CC1)Cc1ccccc1F.
What is the InChIKey of (3R)-3-amino-N-(1,1-dioxo-4-pyridin-2-ylthian-4-yl)-4-(2-fluorophenyl)butanamide?
The InChIKey is KRZBFUVKDUANHY-MRXNPFEDSA-N. The full InChI is InChI=1S/C20H24FN3O3S/c21-17-6-2-1-5-15(17)13-16(22)14-19(25)24-20(18-7-3-4-10-23-18)8-11-28(26,27)12-9-20/h1-7,10,16H,8-9,11-14,22H2,(H,24,25)/t16-/m1/s1.
What are the key properties of (3R)-3-amino-N-(1,1-dioxo-4-pyridin-2-ylthian-4-yl)-4-(2-fluorophenyl)butanamide?
(3R)-3-amino-N-(1,1-dioxo-4-pyridin-2-ylthian-4-yl)-4-(2-fluorophenyl)butanamide has a molecular weight of 405.50 g/mol, XLogP of 1.70, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-amino-N-(1,1-dioxo-4-pyridin-2-ylthian-4-yl)-4-(2-fluorophenyl)butanamide is sourced from PubChem (CID 44589934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).