About 3-pyridin-3-yl-3,6-diazabicyclo[3.1.1]heptane
3-pyridin-3-yl-3,6-diazabicyclo[3.1.1]heptane (PubChem CID 44589968) has the molecular formula C10H13N3
and a molecular weight of 175.24 g/mol. Its IUPAC name is 3-pyridin-3-yl-3,6-diazabicyclo[3.1.1]heptane.
Molecular Properties
| Compound Name | 3-pyridin-3-yl-3,6-diazabicyclo[3.1.1]heptane |
| PubChem CID | 44589968 |
| Molecular Formula | C10H13N3 |
| Molecular Weight | 175.24 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | 3-pyridin-3-yl-3,6-diazabicyclo[3.1.1]heptane |
| SMILES | c1cncc(N2CC3CC(C2)N3)c1 |
| InChI | InChI=1S/C10H13N3/c1-2-10(5-11-3-1)13-6-8-4-9(7-13)12-8/h1-3,5,8-9,12H,4,6-7H2 |
| InChIKey | XRPYIWLXAMYVGT-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.24 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-pyridin-3-yl-3,6-diazabicyclo[3.1.1]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pyridin-3-yl-3,6-diazabicyclo[3.1.1]heptane?
The IUPAC name of 3-pyridin-3-yl-3,6-diazabicyclo[3.1.1]heptane (CID 44589968) is 3-pyridin-3-yl-3,6-diazabicyclo[3.1.1]heptane.
What is the SMILES notation for 3-pyridin-3-yl-3,6-diazabicyclo[3.1.1]heptane?
The canonical SMILES for 3-pyridin-3-yl-3,6-diazabicyclo[3.1.1]heptane is c1cncc(N2CC3CC(C2)N3)c1.
What is the InChIKey of 3-pyridin-3-yl-3,6-diazabicyclo[3.1.1]heptane?
The InChIKey is XRPYIWLXAMYVGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3/c1-2-10(5-11-3-1)13-6-8-4-9(7-13)12-8/h1-3,5,8-9,12H,4,6-7H2.
What are the key properties of 3-pyridin-3-yl-3,6-diazabicyclo[3.1.1]heptane?
3-pyridin-3-yl-3,6-diazabicyclo[3.1.1]heptane has a molecular weight of 175.24 g/mol, XLogP of 0.63, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pyridin-3-yl-3,6-diazabicyclo[3.1.1]heptane is sourced from PubChem (CID 44589968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).