C28H29N7OS — CID 44589971
N-(2-amino-5-thiophen-2-ylphenyl)-6-(2-pyrimidin-2-yl-2,8-diazaspiro[4.5]decan-8-yl)pyridine-3-carboxamide (PubChem CID 44589971) has the molecular formula C28H29N7OS and a molecular weight of 511.66 g/mol. Its IUPAC name is N-(2-amino-5-thiophen-2-ylphenyl)-6-(2-pyrimidin-2-yl-2,8-diazaspiro[4.5]decan-8-yl)pyridine-3-carboxamide.
| Compound Name | N-(2-amino-5-thiophen-2-ylphenyl)-6-(2-pyrimidin-2-yl-2,8-diazaspiro[4.5]decan-8-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 44589971 |
| Molecular Formula | C28H29N7OS |
| Molecular Weight | 511.66 g/mol |
| Exact Mass | 511.22 |
| IUPAC Name | N-(2-amino-5-thiophen-2-ylphenyl)-6-(2-pyrimidin-2-yl-2,8-diazaspiro[4.5]decan-8-yl)pyridine-3-carboxamide |
| SMILES | Nc1ccc(-c2cccs2)cc1NC(=O)c1ccc(N2CCC3(CC2)CCN(c2ncccn2)C3)nc1 |
| InChI | InChI=1S/C28H29N7OS/c29-22-6-4-20(24-3-1-16-37-24)17-23(22)33-26(36)21-5-7-25(32-18-21)34-13-8-28(9-14-34)10-15-35(19-28)27-30-11-2-12-31-27/h1-7,11-12,16-18H,8-10,13-15,19,29H2,(H,33,36) |
| InChIKey | NFQREKHBSNHJAN-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 100.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.66 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|