C22H22F3N3O3S2 — CID 44589986
(3R)-3-amino-N-[4-(1,3-benzothiazol-2-yl)-1,1-dioxothian-4-yl]-4-(2,4,5-trifluorophenyl)butanamide (PubChem CID 44589986) has the molecular formula C22H22F3N3O3S2 and a molecular weight of 497.56 g/mol. Its IUPAC name is (3R)-3-amino-N-[4-(1,3-benzothiazol-2-yl)-1,1-dioxothian-4-yl]-4-(2,4,5-trifluorophenyl)butanamide.
| Compound Name | (3R)-3-amino-N-[4-(1,3-benzothiazol-2-yl)-1,1-dioxothian-4-yl]-4-(2,4,5-trifluorophenyl)butanamide |
|---|---|
| PubChem CID | 44589986 |
| Molecular Formula | C22H22F3N3O3S2 |
| Molecular Weight | 497.56 g/mol |
| Exact Mass | 497.11 |
| IUPAC Name | (3R)-3-amino-N-[4-(1,3-benzothiazol-2-yl)-1,1-dioxothian-4-yl]-4-(2,4,5-trifluorophenyl)butanamide |
| SMILES | N[C@@H](CC(=O)NC1(c2nc3ccccc3s2)CCS(=O)(=O)CC1)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C22H22F3N3O3S2/c23-15-12-17(25)16(24)10-13(15)9-14(26)11-20(29)28-22(5-7-33(30,31)8-6-22)21-27-18-3-1-2-4-19(18)32-21/h1-4,10,12,14H,5-9,11,26H2,(H,28,29)/t14-/m1/s1 |
| InChIKey | RLNFYSABAXZGGZ-CQSZACIVSA-N |
| XLogP | 3.19 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.56 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|