C24H26N4O3S — CID 44590027
4-cyano-N-[(1S)-7-oxo-1-(5-phenyl-1H-imidazol-2-yl)octyl]benzenesulfonamide (PubChem CID 44590027) has the molecular formula C24H26N4O3S and a molecular weight of 450.56 g/mol. Its IUPAC name is 4-cyano-N-[(1S)-7-oxo-1-(5-phenyl-1H-imidazol-2-yl)octyl]benzenesulfonamide.
| Compound Name | 4-cyano-N-[(1S)-7-oxo-1-(5-phenyl-1H-imidazol-2-yl)octyl]benzenesulfonamide |
|---|---|
| PubChem CID | 44590027 |
| Molecular Formula | C24H26N4O3S |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | 4-cyano-N-[(1S)-7-oxo-1-(5-phenyl-1H-imidazol-2-yl)octyl]benzenesulfonamide |
| SMILES | CC(=O)CCCCC[C@H](NS(=O)(=O)c1ccc(C#N)cc1)c1ncc(-c2ccccc2)[nH]1 |
| InChI | InChI=1S/C24H26N4O3S/c1-18(29)8-4-2-7-11-22(24-26-17-23(27-24)20-9-5-3-6-10-20)28-32(30,31)21-14-12-19(16-25)13-15-21/h3,5-6,9-10,12-15,17,22,28H,2,4,7-8,11H2,1H3,(H,26,27)/t22-/m0/s1 |
| InChIKey | OYPJEYZKKZABKM-QFIPXVFZSA-N |
| XLogP | 4.51 |
| TPSA | 115.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|