C23H24F3N3O4S2 — CID 44590038
(3R)-3-amino-N-[4-(5-methoxy-1,3-benzothiazol-2-yl)-1,1-dioxothian-4-yl]-4-(2,4,5-trifluorophenyl)butanamide (PubChem CID 44590038) has the molecular formula C23H24F3N3O4S2 and a molecular weight of 527.59 g/mol. Its IUPAC name is (3R)-3-amino-N-[4-(5-methoxy-1,3-benzothiazol-2-yl)-1,1-dioxothian-4-yl]-4-(2,4,5-trifluorophenyl)butanamide.
| Compound Name | (3R)-3-amino-N-[4-(5-methoxy-1,3-benzothiazol-2-yl)-1,1-dioxothian-4-yl]-4-(2,4,5-trifluorophenyl)butanamide |
|---|---|
| PubChem CID | 44590038 |
| Molecular Formula | C23H24F3N3O4S2 |
| Molecular Weight | 527.59 g/mol |
| Exact Mass | 527.12 |
| IUPAC Name | (3R)-3-amino-N-[4-(5-methoxy-1,3-benzothiazol-2-yl)-1,1-dioxothian-4-yl]-4-(2,4,5-trifluorophenyl)butanamide |
| SMILES | COc1ccc2sc(C3(NC(=O)C[C@H](N)Cc4cc(F)c(F)cc4F)CCS(=O)(=O)CC3)nc2c1 |
| InChI | InChI=1S/C23H24F3N3O4S2/c1-33-15-2-3-20-19(11-15)28-22(34-20)23(4-6-35(31,32)7-5-23)29-21(30)10-14(27)8-13-9-17(25)18(26)12-16(13)24/h2-3,9,11-12,14H,4-8,10,27H2,1H3,(H,29,30)/t14-/m1/s1 |
| InChIKey | KWLYTWVYNIPZMD-CQSZACIVSA-N |
| XLogP | 3.20 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.59 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|