C24H34O4 — CID 44590112
(5R,8S,9R,14R,15S,18R)-4,4,8,15,19,19-hexamethyl-3,20-dioxapentacyclo[11.7.0.02,10.05,9.014,18]icos-1(13)-ene-11,12-dione (PubChem CID 44590112) has the molecular formula C24H34O4 and a molecular weight of 386.53 g/mol. Its IUPAC name is (5R,8S,9R,14R,15S,18R)-4,4,8,15,19,19-hexamethyl-3,20-dioxapentacyclo[11.7.0.02,10.05,9.014,18]icos-1(13)-ene-11,12-dione.
| Compound Name | (5R,8S,9R,14R,15S,18R)-4,4,8,15,19,19-hexamethyl-3,20-dioxapentacyclo[11.7.0.02,10.05,9.014,18]icos-1(13)-ene-11,12-dione |
|---|---|
| PubChem CID | 44590112 |
| Molecular Formula | C24H34O4 |
| Molecular Weight | 386.53 g/mol |
| Exact Mass | 386.25 |
| IUPAC Name | (5R,8S,9R,14R,15S,18R)-4,4,8,15,19,19-hexamethyl-3,20-dioxapentacyclo[11.7.0.02,10.05,9.014,18]icos-1(13)-ene-11,12-dione |
| SMILES | C[C@H]1CC[C@@H]2[C@@H]1C1=C(OC2(C)C)C2OC(C)(C)[C@@H]3CC[C@H](C)[C@H]3C2C(=O)C1=O |
| InChI | InChI=1S/C24H34O4/c1-11-7-9-13-15(11)17-19(25)20(26)18-16-12(2)8-10-14(16)24(5,6)28-22(18)21(17)27-23(13,3)4/h11-17,21H,7-10H2,1-6H3/t11-,12-,13+,14+,15+,16+,17?,21?/m0/s1 |
| InChIKey | NGUCRZKNYHHQIH-XXRBTKBYSA-N |
| XLogP | 4.32 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.53 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|